Content deleted Content added
Updating {{drugbox}} (changes to verified fields - updated 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref') per Chem/Drugbox validation (report [[Wikipedia talk:WikiProject_Ph |
Changing short description from "Chemical compound" to "NSAID anti-inflammatory medication" |
||
(32 intermediate revisions by 21 users not shown) | |||
Line 1:
{{Short description|NSAID anti-inflammatory medication}}
{{Drugbox
| Verifiedfields = changed
|
<!--Clinical data-->
| tradename =
| routes_of_administration = [[intramuscular]]▼
<!--Pharmacokinetic data-->
| metabolism =
| elimination_half-life = 70–100 hours▼
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 3692
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 4VD83UL6Y6
▲| verifiedrevid = 407571001
▲| IUPAC_name = 4-(3-oxobutyl)-1,2-di(phenyl)pyrazolidine-3,5-dione
▲| image = kebuzone.png
▲| CAS_number = 853-34-9
▲| ATC_prefix = M01
▲| ATC_suffix = AA06
▲| PubChem = 3824
▲| DrugBank =
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D01567
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 31749
▲| bioavailability =
<!--Chemical data-->
▲| protein_bound =
|
| smiles = CC(=O)CCC1C(=O)N(N(C1=O)C2=CC=CC=C2)C3=CC=CC=C3
▲| elimination_half-life =
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
▲| excretion =
| StdInChI = 1S/C19H18N2O3/c1-14(22)12-13-17-18(23)20(15-8-4-2-5-9-15)21(19(17)24)16-10-6-3-7-11-16/h2-11,17H,12-13H2,1H3
▲| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
▲| pregnancy_US = <!-- A / B / C / D / X -->
| StdInChIKey = LGYTZKPVOAIUKX-UHFFFAOYSA-N
▲| pregnancy_category=
▲| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
▲| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
▲| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
▲| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
▲| legal_status =
▲| routes_of_administration =
}}
'''Kebuzone''' (or '''ketophenylbutazone''') is a [[nonsteroidal anti-inflammatory drug]] (NSAID) that is used for the treatment of inflammatory conditions such as [[thrombophlebitis]] and [[rheumatoid arthritis]] (RA).<ref name="AustriaCodex">{{cite book|title=Austria-Codex|at=Rheumesser 3 ml-Ampullen|publisher=Österreichischer Apothekerverlag|location=Vienna|year=2018|language=German}}</ref><ref>{{Cite web|url=https://drugs.ncats.io/drug/4VD83UL6Y6| work = NCATS Inxight: Drugs | title = KEBUZONE |language=en|access-date=2019-02-27}}</ref><ref>{{cite book | vauthors = Aronson JK | chapter = Kebuzone |title=Meyler's Side Effects of Drugs: The International Encyclopedia of Adverse Drug Reactions and Interactions |date=2016 |location=Amsterdam |isbn=978-0-444-53716-4 |page=405 |edition=Sixteenth | chapter-url=https://books.google.com/books?id=NOKoBAAAQBAJ&dq=Kebuzone&pg=RA3-PA405}}</ref>
==References==
{{Reflist}}
{{Anti-inflammatory and antirheumatic products}}
[[Category:Ketones]]
[[Category:Pyrazolidindiones]]
[[Category:Nonsteroidal anti-inflammatory drugs]]
|