Jump to content

Bumadizone: Difference between revisions

From Wikipedia, the free encyclopedia
Content deleted Content added
CAS#
Importing Wikidata short description: "Chemical compound" (Shortdesc helper)
 
(18 intermediate revisions by 15 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{Drugbox
{{Drugbox
| Watchedfields = changed
| verifiedrevid = 376084716
| verifiedrevid = 444466595
| IUPAC_name = 2-[phenyl-(phenylamino)carbamoyl]hexanoic acid
| IUPAC_name = 2-[phenyl-(phenylamino)carbamoyl]hexanoic acid
| image = bumadizone.png
| image = bumadizone.png
| CAS_number = 3583-64-0

| ATC_prefix = M01
<!--Clinical data-->
| ATC_suffix = AB07
| tradename =
| PubChem = 19161
| Drugs.com = {{drugs.com|international|bumadizone}}
| DrugBank =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| C=19|H=22|N=2|O=3
| pregnancy_US = <!-- A / B / C / D / X -->
| molecular_weight = 326.38958 g/mol
| pregnancy_category =
| bioavailability =
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| protein_bound =
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| metabolism =
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| elimination_half-life =
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| excretion =
| legal_status =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| routes_of_administration =
| pregnancy_US = <!-- A / B / C / D / X -->

| pregnancy_category=
<!--Pharmacokinetic data-->
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| bioavailability =
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| protein_bound =
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| metabolism =
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| elimination_half-life =
| legal_status =
| excretion =
| routes_of_administration =

<!--Identifiers-->
| CAS_number = 3583-64-0
| ATC_prefix = M01
| ATC_suffix = AB07
| PubChem = 19161
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChEBI = 76119
| ChEMBL = 2105456
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = ATD81G944M
| ChemSpiderID = 18080
| smiles = O=C(O)C(C(=O)N(Nc1ccccc1)c2ccccc2)CCCC
| StdInChI = 1S/C19H22N2O3/c1-2-3-14-17(19(23)24)18(22)21(16-12-8-5-9-13-16)20-15-10-6-4-7-11-15/h4-13,17,20H,2-3,14H2,1H3,(H,23,24)
| StdInChIKey = FLWFHHFTIRLFPV-UHFFFAOYSA-N

<!--Chemical data-->
| C=19 | H=22 | N=2 | O=3
}}
}}


'''Bumadizone''' is a [[non-steroidal anti-inflammatory drug]]. It may be also named bumazidone.
'''Bumadizone''', or '''bumazidone''', is a [[nonsteroidal anti-inflammatory drug]] (NSAID).

==References==
{{Reflist|2}}



{{Anti-inflammatory and antirheumatic products}}
{{Anti-inflammatory and antirheumatic products}}
{{Prostanoid signaling modulators}}
{{NSAIDs}}

[[Category:Hydrazides]]
[[Category:Hydrazides]]
[[Category:Non-steroidal anti-inflammatory drugs]]
[[Category:Nonsteroidal anti-inflammatory drugs]]




{{musculoskeletal-drug-stub}}
{{musculoskeletal-drug-stub}}

[[hu:Bumadizon]]

Latest revision as of 03:06, 12 April 2022

Bumadizone
Clinical data
AHFS/Drugs.comInternational Drug Names
ATC code
Identifiers
  • 2-[phenyl-(phenylamino)carbamoyl]hexanoic acid
CAS Number
PubChem CID
ChemSpider
UNII
ChEBI
ChEMBL
CompTox Dashboard (EPA)
ECHA InfoCard100.020.646 Edit this at Wikidata
Chemical and physical data
FormulaC19H22N2O3
Molar mass326.396 g·mol−1
3D model (JSmol)
  • O=C(O)C(C(=O)N(Nc1ccccc1)c2ccccc2)CCCC
  • InChI=1S/C19H22N2O3/c1-2-3-14-17(19(23)24)18(22)21(16-12-8-5-9-13-16)20-15-10-6-4-7-11-15/h4-13,17,20H,2-3,14H2,1H3,(H,23,24)
  • Key:FLWFHHFTIRLFPV-UHFFFAOYSA-N
  (verify)

Bumadizone, or bumazidone, is a nonsteroidal anti-inflammatory drug (NSAID).

References

[edit]