Bumadizone: Difference between revisions
Appearance
Content deleted Content added
Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Wikipedia:WikiProject Chemicals/Chembox validati |
Importing Wikidata short description: "Chemical compound" (Shortdesc helper) |
||
(15 intermediate revisions by 14 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{drugbox |
|||
{{Drugbox |
|||
| Watchedfields = changed |
|||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Clinical data--> |
|||
| tradename = |
|||
| Drugs.com = {{drugs.com|international|bumadizone}} |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Pharmacokinetic data--> |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Identifiers--> |
|||
⚫ | |||
⚫ | |||
⚫ | |||
| PubChem = 19161 |
|||
⚫ | |||
⚫ | |||
| ChEBI = 76119 |
|||
| ChEMBL = 2105456 |
|||
| UNII_Ref = {{fdacite|correct|FDA}} |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
| UNII = ATD81G944M |
| UNII = ATD81G944M |
||
| ChemSpiderID = 18080 |
|||
⚫ | |||
| smiles = O=C(O)C(C(=O)N(Nc1ccccc1)c2ccccc2)CCCC |
|||
⚫ | |||
| StdInChI = 1S/C19H22N2O3/c1-2-3-14-17(19(23)24)18(22)21(16-12-8-5-9-13-16)20-15-10-6-4-7-11-15/h4-13,17,20H,2-3,14H2,1H3,(H,23,24) |
|||
⚫ | |||
| StdInChIKey = FLWFHHFTIRLFPV-UHFFFAOYSA-N |
|||
⚫ | |||
⚫ | |||
<!--Chemical data--> |
|||
⚫ | |||
| |
| C=19 | H=22 | N=2 | O=3 |
||
⚫ | |||
⚫ | |||
| C=19|H=22|N=2|O=3 |
|||
| molecular_weight = 326.38958 g/mol |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
}} |
}} |
||
'''Bumadizone''' is a [[ |
'''Bumadizone''', or '''bumazidone''', is a [[nonsteroidal anti-inflammatory drug]] (NSAID). |
||
==References== |
|||
{{Reflist|2}} |
|||
{{Anti-inflammatory and antirheumatic products}} |
{{Anti-inflammatory and antirheumatic products}} |
||
{{Prostanoid signaling modulators}} |
|||
{{NSAIDs}} |
|||
[[Category:Hydrazides]] |
[[Category:Hydrazides]] |
||
[[Category: |
[[Category:Nonsteroidal anti-inflammatory drugs]] |
||
{{musculoskeletal-drug-stub}} |
{{musculoskeletal-drug-stub}} |
||
[[hu:Bumadizon]] |
Latest revision as of 03:06, 12 April 2022
Clinical data | |
---|---|
AHFS/Drugs.com | International Drug Names |
ATC code | |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
ChemSpider | |
UNII | |
ChEBI | |
ChEMBL | |
CompTox Dashboard (EPA) | |
ECHA InfoCard | 100.020.646 |
Chemical and physical data | |
Formula | C19H22N2O3 |
Molar mass | 326.396 g·mol−1 |
3D model (JSmol) | |
| |
| |
(verify) |
Bumadizone, or bumazidone, is a nonsteroidal anti-inflammatory drug (NSAID).
References
[edit]