Jump to content

Flexuosol A: Difference between revisions

From Wikipedia, the free encyclopedia
Browse history interactively
← Previous edit
Content deleted Content added
VisualWikitext
Citation bot (talk | contribs)
Bots
5,063,229 edits
m [394]Add: title, year, last1, first1, last2, first2, last3, first3, journal, volume, issue, pages, pmid. Tweak: pages. Formatted dashes. | Edgar181
m Added UNII
 
(14 intermediate revisions by 7 users not shown)
Line 6: Line 6:
| ImageName = Chemical structure of flexuosol A
| ImageName = Chemical structure of flexuosol A
| ImageAlt = Chemical structure of flexuosol A
| ImageAlt = Chemical structure of flexuosol A
| PIN = 5-[(2''R'',3''R'')-4-{(2''S'',3''S'',5''R'',6''R'')-5-(3,5-Dihydroxyphenyl)-2,6-bis(4-hydroxyphenyl)-4-[(''E'')-2-(4-hydroxyphenyl)ethen-1-yl]-2,3,5,6-tetrahydro(benzo[1,2-''b'':5,4-''b''′]difuran)-3-yl}-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-3-yl]benzene-1,3-diol
| IUPACName =
| OtherNames =
| OtherNames =
|Section1= {{Chembox Identifiers
|Section1={{Chembox Identifiers
| CASNo = 205440-11-5
| CASNo = 205440-11-5
| CASNo_Ref = {{cascite|correct|}}
| CASNo_Ref = {{cascite|correct|}}
| CASOther =
| CASNoOther =
| UNII_Ref = {{fdacite|correct|FDA}}
⚫
| PubChem =
| UNII = 8256ST4BZK
⚫
| PubChem = 71308201
| StdInChI=1S/C56H42O11/c57-35-13-4-29(5-14-35)6-21-44-51-46(66-55(31-9-17-37(59)18-10-31)49(51)34-24-41(63)27-42(64)25-34)28-47-52(44)53(56(67-47)32-11-19-38(60)20-12-32)43-2-1-3-45-50(43)48(33-22-39(61)26-40(62)23-33)54(65-45)30-7-15-36(58)16-8-30/h1-28,48-49,53-64H/b21-6+/t48-,49-,53+,54+,55+,56-/m1/s1
| StdInChIKey = AZTITUGYPXKUCV-CGOOCLRTSA-N
| SMILES = OC1=CC([C@H]2[C@H](C3=CC=C(O)C=C3)OC4=CC5=C([C@@](C6=CC=CC7=C6[C@@H](C8=CC(O)=CC(O)=C8)[C@H](C9=CC=C(O)C=C9)O7)([H])[C@@H](C%10=CC=C(O)C=C%10)O5)C(/C=C/C%11=CC=C(O)C=C%11)=C42)=CC(O)=C1
| SMILES = OC1=CC([C@H]2[C@H](C3=CC=C(O)C=C3)OC4=CC5=C([C@@](C6=CC=CC7=C6[C@@H](C8=CC(O)=CC(O)=C8)[C@H](C9=CC=C(O)C=C9)O7)([H])[C@@H](C%10=CC=C(O)C=C%10)O5)C(/C=C/C%11=CC=C(O)C=C%11)=C42)=CC(O)=C1
| ChemSpiderID_Ref =
| ChemSpiderID_Ref =
| ChemSpiderID =
| ChemSpiderID =
| InChI =
| InChIKey =
| StdInChI_Ref =
| StdInChI =
| StdInChIKey_Ref =
| StdInChIKey =
| MeSHName =
| MeSHName =
}}
}}
|Section2= {{Chembox Properties
|Section2={{Chembox Properties
| C=56|H=42|O=12
| C=56 | H=42 | O=12
| ExactMass = 906.267627 u
| Appearance =
| Appearance =
| Density =
| Density =
| MeltingPt = <!-- °C -->
| MeltingPt =
| BoilingPt = <!-- °C -->
| BoilingPt =
| Solubility =
| Solubility =
}}
}}
| Section3 = {{Chembox Hazards
|Section3={{Chembox Hazards
| MainHazards =
| MainHazards =
| FlashPt =
| FlashPt =
| Autoignition =
| AutoignitionPt =
| RPhrases = <!-- {{R10}}, {{R23}}, {{R34}}, {{R50}} etc. -->
| GHS_ref=<!-- no GHS data in PubChem Dec2021 -->
| SPhrases = <!-- {{S1/2}}, {{S9}}, {{S16}}, {{S26}}, {{S36/37/39}}, {{S45}}, {{S61}} etc. -->
}}
}}
}}
}}
⚫
'''Flexuosol A''' is a resveratrol [[tetramer (chemistry)|tetramer]] found in ''[[Vitis flexuosa]]''.<ref>{{cite journal | doi = 10.1021/np970457v | title = Flexuosol A, a New Tetrastilbene fromVitis flexuosa | year = 1998 | last1 = Li | first1 = Wen-wu | last2 = Li | first2 = Bo-Gang | last3 = Chen | first3 = Yao-zu | journal = Journal of Natural Products | volume = 61 | issue = 5 | pages = 646–7 | pmid = 9599267}}</ref>

⚫
'''Flexuosol A''' is a stilbene [[tetramer (chemistry)|tetramer]] found in ''[[Vitis flexuosa]]''.<ref>{{cite journal | doi = 10.1021/np970457v | title = Flexuosol A, a New Tetrastilbene fromVitis flexuosa | year = 1998 | last1 = Li | first1 = Wen-wu | last2 = Li | first2 = Bo-Gang | last3 = Chen | first3 = Yao-zu | journal = Journal of Natural Products | volume = 61 | issue = 5 | pages = 646–7 | pmid = 9599267}}</ref>


== References ==
== References ==
{{reflist}}
{{reflist}}


{{Stilbenoids}}
{{Oligostilbenoid}}

[[Category:Resveratrol oligomers]]
[[Category:Natural phenol tetramers]]
⚫
[[Category:Grape]]


⚫
[[Category:Stilbenoids]]


{{Natural phenol-stub}}
{{aromatic-stub}}

Latest revision as of 13:30, 18 August 2022

Flexuosol A
Chemical structure of flexuosol A
Names
Preferred IUPAC name
5-[(2R,3R)-4-{(2S,3S,5R,6R)-5-(3,5-Dihydroxyphenyl)-2,6-bis(4-hydroxyphenyl)-4-[(E)-2-(4-hydroxyphenyl)ethen-1-yl]-2,3,5,6-tetrahydro(benzo[1,2-b:5,4-b′]difuran)-3-yl}-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-3-yl]benzene-1,3-diol
Identifiers
3D model (JSmol)
UNII
  • InChI=1S/C56H42O11/c57-35-13-4-29(5-14-35)6-21-44-51-46(66-55(31-9-17-37(59)18-10-31)49(51)34-24-41(63)27-42(64)25-34)28-47-52(44)53(56(67-47)32-11-19-38(60)20-12-32)43-2-1-3-45-50(43)48(33-22-39(61)26-40(62)23-33)54(65-45)30-7-15-36(58)16-8-30/h1-28,48-49,53-64H/b21-6+/t48-,49-,53+,54+,55+,56-/m1/s1
    Key: AZTITUGYPXKUCV-CGOOCLRTSA-N
  • OC1=CC([C@H]2[C@H](C3=CC=C(O)C=C3)OC4=CC5=C([C@@](C6=CC=CC7=C6[C@@H](C8=CC(O)=CC(O)=C8)[C@H](C9=CC=C(O)C=C9)O7)([H])[C@@H](C%10=CC=C(O)C=C%10)O5)C(/C=C/C%11=CC=C(O)C=C%11)=C42)=CC(O)=C1
Properties
C56H42O12
Molar mass 906.940 g·mol−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).

Flexuosol A is a resveratrol tetramer found in Vitis flexuosa.[1]

References

[edit]
  1. ^ Li, Wen-wu; Li, Bo-Gang; Chen, Yao-zu (1998). "Flexuosol A, a New Tetrastilbene fromVitis flexuosa". Journal of Natural Products. 61 (5): 646–7. doi:10.1021/np970457v. PMID 9599267.


Stub icon

This article about an aromatic compound is a stub. You can help Wikipedia by expanding it.

Retrieved from "https://en.wikipedia.org/w/index.php?title=Flexuosol_A&oldid=1105091446"