Jump to content

Cadralazine: Difference between revisions

From Wikipedia, the free encyclopedia
Browse history interactively
← Previous edit
Content deleted Content added
VisualWikitext
added PubchemID, CSID, (Std)InChI & (Std)InChIKey
Importing Wikidata short description: "Chemical compound"
 
(20 intermediate revisions by 14 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{Drugbox
{{Drugbox
| Verifiedfields = changed
⚫
| verifiedrevid = 443300058
| Watchedfields = changed
⚫
| IUPAC_name = ethoxy-''N'''-{6-[ethyl(2-hydroxypropyl)amino]pyridazin-3-yl}carbohydrazide
⚫
| verifiedrevid = 443953677
⚫
| image = Cadralazine.png
⚫
| IUPAC_name = Ethoxy-''N'''-<nowiki/>{6-[ethyl(2-hydroxypropyl)amino]pyridazin-3-yl}carbohydrazide
⚫
| image = Cadralazine.svg
| width = 250
| image2 = Cadralazine-3D-spacefill.png
| width2 = 180
| alt2 = Cadralazine molecule


<!--Clinical data-->
<!--Clinical data-->
| tradename =
| tradename =
| Drugs.com = {{drugs.com|international|cadralazine}}
| Drugs.com = {{drugs.com|international|cadralazine}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| legal_status =
| routes_of_administration =
| routes_of_administration =


<!--Pharmacokinetic data-->
<!--Pharmacokinetic data-->
| bioavailability =
| bioavailability =
| protein_bound =
| protein_bound =
| metabolism =
| metabolism =
| elimination_half-life =
| elimination_half-life =
| excretion =
| excretion =


<!--Identifiers-->
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 64241-34-5
| CAS_number = 64241-34-5
| ATC_prefix = C02
| ATC_prefix = C02
| ATC_suffix = DB04
| ATC_suffix = DB04
| PubChem = 2515
| PubChem = 2515
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 2106561
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 8T96I3U713
| UNII = 8T96I3U713
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 2420
| ChemSpiderID = 2420
| chemical_formula = C<sub>12</sub>H<sub>21</sub>N<sub>5</sub>O<sub>3</sub>
⚫
| smiles = O=C(OCC)NNc1nnc(N(CC(O)C)CC)cc1
| molecular_weight = 283.327
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
⚫
| smiles = O=C(OCC)NNc1nnc(N(CC(O)C)CC)cc1
| InChI = 1/C12H21N5O3/c1-4-17(8-9(3)18)11-7-6-10(13-15-11)14-16-12(19)20-5-2/h6-7,9,18H,4-5,8H2,1-3H3,(H,13,14)(H,16,19)
| StdInChI = 1S/C12H21N5O3/c1-4-17(8-9(3)18)11-7-6-10(13-15-11)14-16-12(19)20-5-2/h6-7,9,18H,4-5,8H2,1-3H3,(H,13,14)(H,16,19)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| InChIKey = QLTVVOATEHFXLT-UHFFFAOYAD
| StdInChIKey = QLTVVOATEHFXLT-UHFFFAOYSA-N
| StdInChI = 1S/C12H21N5O3/c1-4-17(8-9(3)18)11-7-6-10(13-15-11)14-16-12(19)20-5-2/h6-7,9,18H,4-5,8H2,1-3H3,(H,13,14)(H,16,19)
| StdInChIKey = QLTVVOATEHFXLT-UHFFFAOYSA-N


<!--Chemical data-->
<!--Chemical data-->
| C=12 | H=21 | N=5 | O=3
| C=12 | H=21 | N=5 | O=3
| molecular_weight = 283.33 g/mol
}}
}}


'''Cadralazine''' is an [[antihypertensive]] of the [[hydrazinophthalazine]] [[chemical class]].<ref name="pmid2083513">{{cite journal | vauthors = McTavish D, Young RA, Clissold SP | title = Cadralazine. A review of its pharmacodynamic and pharmacokinetic properties, and therapeutic potential in the treatment of hypertension | journal = Drugs | volume = 40 | issue = 4 | pages = 543–60 | date = October 1990 | pmid = 2083513 | doi = 10.2165/00003495-199040040-00005 }}</ref>
'''Cadralazine''' is an [[antihypertensive]] of the [[hydrazine]] [[chemical class]].

== See also ==
* [[Dihydralazine]]
* [[Endralazine]]
* [[Hydralazine]]


== References ==
== References ==
{{Reflist|2}}
{{Reflist}}



{{Nonsympatholytic vasodilatory antihypertensives}}
{{Nonsympatholytic vasodilatory antihypertensives}}
{{Hydrazines}}
{{Hydrazines}}


⚫
[[Category:Secondary alcohols]]


⚫
[[Category:Pyridazines]]
[[Category:Carbamates]]
[[Category:Carbamates]]
[[Category:Hydrazides]]
[[Category:Hydrazides]]
[[Category:Alcohols]]
[[Category:Pyridazines]]
[[Category:Ethyl esters]]



{{antihypertensive-stub}}
{{antihypertensive-stub}}

[[es:Cadralazina]]

Latest revision as of 23:17, 25 April 2023

Cadralazine
Cadralazine molecule
Clinical data
AHFS/Drugs.comInternational Drug Names
ATC code
Identifiers
  • Ethoxy-N'-{6-[ethyl(2-hydroxypropyl)amino]pyridazin-3-yl}carbohydrazide
CAS Number
PubChem CID
ChemSpider
UNII
ChEMBL
CompTox Dashboard (EPA)
Chemical and physical data
FormulaC12H21N5O3
Molar mass283.332 g·mol−1
3D model (JSmol)
  • O=C(OCC)NNc1nnc(N(CC(O)C)CC)cc1
  • InChI=1S/C12H21N5O3/c1-4-17(8-9(3)18)11-7-6-10(13-15-11)14-16-12(19)20-5-2/h6-7,9,18H,4-5,8H2,1-3H3,(H,13,14)(H,16,19) ☒N
  • Key:QLTVVOATEHFXLT-UHFFFAOYSA-N ☒N
 ☒NcheckY (what is this?)  (verify)

Cadralazine is an antihypertensive of the hydrazinophthalazine chemical class.[1]

References

[edit]
  1. ^ McTavish D, Young RA, Clissold SP (October 1990). "Cadralazine. A review of its pharmacodynamic and pharmacokinetic properties, and therapeutic potential in the treatment of hypertension". Drugs. 40 (4): 543–60. doi:10.2165/00003495-199040040-00005. PMID 2083513.
Stub icon

This antihypertensive-related article is a stub. You can help Wikipedia by expanding it.

Retrieved from "https://en.wikipedia.org/w/index.php?title=Cadralazine&oldid=1151737472"