Jump to content

Kebuzone: Difference between revisions

From Wikipedia, the free encyclopedia
Content deleted Content added
CheMoBot (talk | contribs)
Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation
Changing short description from "Chemical compound" to "NSAID anti-inflammatory medication"
 
(29 intermediate revisions by 20 users not shown)
Line 1: Line 1:
{{Short description|NSAID anti-inflammatory medication}}
{{drugbox
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 447986588
| IUPAC_name = 4-(3-oxobutyl)-1,2-di(phenyl)pyrazolidine-3,5-dione
| image = Kebuzone.png

<!--Clinical data-->
| tradename =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration = [[intramuscular]]

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life = 70–100 hours
| excretion = [[renal]]

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 853-34-9
| ATC_prefix = M01
| ATC_suffix = AA06
| PubChem = 3824
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 3692
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB08940
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 4VD83UL6Y6
| UNII = 4VD83UL6Y6
| verifiedrevid = 443643103
| IUPAC_name = 4-(3-oxobutyl)-1,2-di(phenyl)pyrazolidine-3,5-dione
| image = kebuzone.png
| CAS_number = 853-34-9
| ATC_prefix = M01
| ATC_suffix = AA06
| PubChem = 3824
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D01567
| KEGG = D01567
| ChEBI_Ref = {{ebicite|changed|EBI}}
| C=19|H=18|N=2|O=3
| ChEBI = 31749
| molecular_weight = 322.35782 g/mol

| bioavailability =
<!--Chemical data-->
| protein_bound =
| metabolism =
| C=19 | H=18 | N=2 | O=3
| smiles = CC(=O)CCC1C(=O)N(N(C1=O)C2=CC=CC=C2)C3=CC=CC=C3
| elimination_half-life =
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| excretion =
| StdInChI = 1S/C19H18N2O3/c1-14(22)12-13-17-18(23)20(15-8-4-2-5-9-15)21(19(17)24)16-10-6-3-7-11-16/h2-11,17H,12-13H2,1H3
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| pregnancy_US = <!-- A / B / C / D / X -->
| StdInChIKey = LGYTZKPVOAIUKX-UHFFFAOYSA-N
| pregnancy_category=
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =
}}
}}


'''Kebuzone''' (or '''ketophenylbutazone''') is a [[nonsteroidal anti-inflammatory drug]] (NSAID) that is used for the treatment of inflammatory conditions such as [[thrombophlebitis]] and [[rheumatoid arthritis]] (RA).<ref name="AustriaCodex">{{cite book|title=Austria-Codex|at=Rheumesser 3 ml-Ampullen|publisher=Österreichischer Apothekerverlag|location=Vienna|year=2018|language=German}}</ref><ref>{{Cite web|url=https://drugs.ncats.io/drug/4VD83UL6Y6| work = NCATS Inxight: Drugs | title = KEBUZONE |language=en|access-date=2019-02-27}}</ref><ref>{{cite book | vauthors = Aronson JK | chapter = Kebuzone |title=Meyler's Side Effects of Drugs: The International Encyclopedia of Adverse Drug Reactions and Interactions |date=2016 |location=Amsterdam |isbn=978-0-444-53716-4 |page=405 |edition=Sixteenth | chapter-url=https://books.google.com/books?id=NOKoBAAAQBAJ&dq=Kebuzone&pg=RA3-PA405}}</ref>
'''Kebuzone''' (or '''ketophenylbutazone''') is a [[non-steroidal anti-inflammatory drug]].


==References==
{{Reflist}}




{{Anti-inflammatory and antirheumatic products}}
{{Anti-inflammatory and antirheumatic products}}
{{NSAIDs}}



[[Category:Ketones]]
[[Category:Ketones]]
[[Category:Pyrazolidindiones]]
[[Category:Pyrazolidindiones]]
[[Category:Nonsteroidal anti-inflammatory drugs]]




{{musculoskeletal-drug-stub}}
{{musculoskeletal-drug-stub}}

[[hu:Kebuzon]]

Latest revision as of 00:18, 27 October 2023

Kebuzone
Clinical data
Routes of
administration
intramuscular
ATC code
Pharmacokinetic data
Elimination half-life70–100 hours
Excretionrenal
Identifiers
  • 4-(3-oxobutyl)-1,2-di(phenyl)pyrazolidine-3,5-dione
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
KEGG
ChEBI
CompTox Dashboard (EPA)
ECHA InfoCard100.011.560 Edit this at Wikidata
Chemical and physical data
FormulaC19H18N2O3
Molar mass322.364 g·mol−1
3D model (JSmol)
  • CC(=O)CCC1C(=O)N(N(C1=O)C2=CC=CC=C2)C3=CC=CC=C3
  • InChI=1S/C19H18N2O3/c1-14(22)12-13-17-18(23)20(15-8-4-2-5-9-15)21(19(17)24)16-10-6-3-7-11-16/h2-11,17H,12-13H2,1H3 ☒N
  • Key:LGYTZKPVOAIUKX-UHFFFAOYSA-N ☒N
 ☒NcheckY (what is this?)  (verify)

Kebuzone (or ketophenylbutazone) is a nonsteroidal anti-inflammatory drug (NSAID) that is used for the treatment of inflammatory conditions such as thrombophlebitis and rheumatoid arthritis (RA).[1][2][3]

References

[edit]
  1. ^ Austria-Codex (in German). Vienna: Österreichischer Apothekerverlag. 2018. Rheumesser 3 ml-Ampullen.
  2. ^ "KEBUZONE". NCATS Inxight: Drugs. Retrieved 2019-02-27.
  3. ^ Aronson JK (2016). "Kebuzone". Meyler's Side Effects of Drugs: The International Encyclopedia of Adverse Drug Reactions and Interactions (Sixteenth ed.). Amsterdam. p. 405. ISBN 978-0-444-53716-4.{{cite book}}: CS1 maint: location missing publisher (link)