Spiraprilat: Difference between revisions
Appearance
Content deleted Content added
m molar mass: correct unit (should be g/mol). No need to link SI units. rm depr parameter imagename (via AWB script) |
Zakblade2000 (talk | contribs) No edit summary |
||
(14 intermediate revisions by 11 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{unreferenced|date=May 2011}} |
|||
{{cs1 config|name-list-style=vanc}} |
|||
{{Drugbox |
{{Drugbox |
||
| IUPAC_name = ( |
| IUPAC_name = (8''S'')-7-[(2''S'')-2-<nowiki/>{[(1''S'')-1-Carboxy-3-phenylpropyl]amino}propanoyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid |
||
| image = Spiraprilat.svg |
| image = Spiraprilat.svg |
||
| width = 222 |
| width = 222 |
||
Line 30: | Line 31: | ||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
⚫ | |||
| CAS_number = |
| CAS_number = 83602-05-5 |
||
| CAS_supplemental = |
|||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
⚫ | |||
| ATCvet = |
| ATCvet = |
||
| ATC_prefix = <!-- 'none' if uncategorised --> |
| ATC_prefix = <!-- 'none' if uncategorised --> |
||
Line 39: | Line 43: | ||
| PubChemSubstance = |
| PubChemSubstance = |
||
| IUPHAR_ligand = 6576 |
| IUPHAR_ligand = 6576 |
||
| DrugBank = |
| DrugBank = |
||
| ChEBI = 141522 |
|||
⚫ | |||
⚫ | |||
| ChEMBL = 579 |
| ChEMBL = 579 |
||
| synonyms = |
| synonyms = |
||
Line 48: | Line 51: | ||
<!--Chemical data--> |
<!--Chemical data--> |
||
| chemical_formula = |
| chemical_formula = |
||
| C=20 | H=26 | |
| C=20 | H=26 | N=2 | O=5 | S=2 |
||
| N=2 | Na= |
|||
| O=5 | P= | Pt= |
|||
| S=2 | Se= | Sr= | Tc=| charge = |
|||
| molecular_weight = 438.6 g/mol |
|||
| SMILES = C[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N2CC3(C[C@H]2C(=O)O)SCCS3 |
| SMILES = C[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N2CC3(C[C@H]2C(=O)O)SCCS3 |
||
| StdInChI =1S/C20H26N2O5S2/c1-13(21-15(18(24)25)8-7-14-5-3-2-4-6-14)17(23)22-12-20(28-9-10-29-20)11-16(22)19(26)27/h2-6,13,15-16,21H,7-12H2,1H3,(H,24,25)(H,26,27)/t13-,15-,16-/m0/s1 |
| StdInChI =1S/C20H26N2O5S2/c1-13(21-15(18(24)25)8-7-14-5-3-2-4-6-14)17(23)22-12-20(28-9-10-29-20)11-16(22)19(26)27/h2-6,13,15-16,21H,7-12H2,1H3,(H,24,25)(H,26,27)/t13-,15-,16-/m0/s1 |
||
| StdInChIKey = FMMDBLMCSDRUPA-BPUTZDHNSA-N |
| StdInChIKey = FMMDBLMCSDRUPA-BPUTZDHNSA-N |
||
| InChI = 1/C20H26N2O5S2/c1-13(21-15(18(24)25)8-7-14-5-3-2-4-6-14)17(23)22-12-20(28-9-10-29-20)11-16(22)19(26)27/h2-6,13,15-16,21H,7-12H2,1H3,(H,24,25)(H,26,27)/t13-,15-,16-/m0/s1 |
|||
| InChIKey = FMMDBLMCSDRUPA-BPUTZDHNBY |
|||
| density = |
| density = |
||
| melting_point = |
| melting_point = |
||
Line 69: | Line 66: | ||
}} |
}} |
||
'''Spiraprilat''' is the [[active metabolite]] of [[spirapril]].<ref>{{cite journal | vauthors = Noble S, Sorkin EM | title = Spirapril. A preliminary review of its pharmacology and therapeutic efficacy in the treatment of hypertension | journal = Drugs | volume = 49 | issue = 5 | pages = 750–66 | date = May 1995 | pmid = 7601014 | doi = 10.2165/00003495-199549050-00008 | s2cid = 195691037 }}</ref> |
|||
'''Spiraprilat''' is the [[active metabolite]] of [[Spirapril]]. |
|||
==References== |
|||
{{Reflist}} |
|||
==External links== |
|||
*{{Commonscatinline}} |
|||
{{Angiotensin receptor modulators}} |
|||
[[Category:ACE inhibitors]] |
[[Category:ACE inhibitors]] |
||
[[Category:Human drug metabolites]] |
|||
[[Category:1,3-Dithiolanes]] |
|||
Latest revision as of 09:31, 9 May 2024
Identifiers | |
---|---|
| |
CAS Number | |
PubChem CID | |
IUPHAR/BPS | |
ChemSpider | |
UNII | |
ChEBI | |
ChEMBL | |
CompTox Dashboard (EPA) | |
Chemical and physical data | |
Formula | C20H26N2O5S2 |
Molar mass | 438.56 g·mol−1 |
3D model (JSmol) | |
| |
|
Spiraprilat is the active metabolite of spirapril.[1]
References
[edit]External links
[edit]- Media related to Spiraprilat at Wikimedia Commons