Quinaprilat: Difference between revisions
Appearance
Content deleted Content added
auto mw |
|||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
{{Short description|Chemical compound}} |
||
{{Drugbox |
{{Drugbox |
||
| IUPAC_name = (3''S'')-2-[(2''S'')-2- |
| IUPAC_name = (3''S'')-2-[(2''S'')-2-{{!((}}(1''S'')-1-carboxy-3-phenylpropyl]amino]propanoyl]-3,4-dihydro-1''H''-isoquinoline-3-carboxylic acid |
||
| image = Quinaprilat structure.svg |
| image = Quinaprilat structure.svg |
||
| width = 222 |
|||
| alt = |
| alt = |
||
| image2 = |
| image2 = |
||
Line 48: | Line 47: | ||
| chemical_formula = |
| chemical_formula = |
||
| C=23 | H=26 | N=2 | O=5 |
| C=23 | H=26 | N=2 | O=5 |
||
| molecular_weight = 410.46294 |
|||
| SMILES = C[C@@H](C(=O)N1CC2=CC=CC=C2C[C@H]1C(=O)O)N[C@@H](CCC3=CC=CC=C3)C(=O)O |
| SMILES = C[C@@H](C(=O)N1CC2=CC=CC=C2C[C@H]1C(=O)O)N[C@@H](CCC3=CC=CC=C3)C(=O)O |
||
| StdInChI = 1S/C23H26N2O5/c1-15(24-19(22(27)28)12-11-16-7-3-2-4-8-16)21(26)25-14-18-10-6-5-9-17(18)13-20(25)23(29)30/h2-10,15,19-20,24H,11-14H2,1H3,(H,27,28)(H,29,30)/t15-,19-,20-/m0/s1 |
| StdInChI = 1S/C23H26N2O5/c1-15(24-19(22(27)28)12-11-16-7-3-2-4-8-16)21(26)25-14-18-10-6-5-9-17(18)13-20(25)23(29)30/h2-10,15,19-20,24H,11-14H2,1H3,(H,27,28)(H,29,30)/t15-,19-,20-/m0/s1 |
Latest revision as of 09:48, 23 March 2024
Clinical data | |
---|---|
Other names | CI-928 |
ATC code |
|
Identifiers | |
| |
CAS Number | |
IUPHAR/BPS | |
ChemSpider | |
UNII | |
ChEMBL | |
CompTox Dashboard (EPA) | |
Chemical and physical data | |
Formula | C23H26N2O5 |
Molar mass | 410.470 g·mol−1 |
3D model (JSmol) | |
| |
|
Quinaprilat is the active metabolite of quinapril.[1]