Δ-Tocopherol: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
-{{DISPLAYTITLE:''delta''-Tocopherol}}
+{{DISPLAYTITLE:δ-Tocopherol}}
 {{chembox
+| Verifiedfields = changed
-| verifiedrevid = 443563737
+| verifiedrevid = 443565389
-|Reference=<ref>[http://www.sigmaaldrich.com/catalog/ProductDetail.do?N4=T2028|SIGMA&N5=SEARCH_CONCAT_PNO|BRAND_KEY&F=SPEC (+)-δ-Tocopherol] at [[Sigma-Aldrich]]</ref>
+| Reference = <ref>[http://www.sigmaaldrich.com/catalog/ProductDetail.do?N4=T2028|SIGMA&N5=SEARCH_CONCAT_PNO|BRAND_KEY&F=SPEC (+)-δ-Tocopherol] at [[Sigma-Aldrich]]</ref>
-|Name=δ-Tocopherol
+| Name = δ-Tocopherol
-|ImageFile=Delta-tocopherol.png
+| ImageFile = Delta-tocopherol.png
-|ImageSize=200px
+| ImageSize = 200px
-|IUPACName=(2''R'')-2,8-Dimethyl-2-[(4''R'',8''R'')-4,8,12-trimethyltridecyl]-6-chromanol
+| PIN = (2''R'')-2,8-Dimethyl-2-[(4''R'',8''R'')-4,8,12-trimethyltridecyl]-2''H''-1-benzopyran-6-ol
-|OtherNames=
+| OtherNames =
 |Section1={{Chembox Identifiers
-|  ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
+| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
 | ChemSpiderID = 83144
 | UNII_Ref = {{fdacite|correct|FDA}}
@@ Line 20: / Line 21: @@
 | StdInChIKey = GZIFEOYASATJEH-VHFRWLAGSA-N
 | CASNo_Ref = {{cascite|correct|CAS}}
-| CASNo=119-13-1
+| CASNo = 119-13-1
+| ChEMBL_Ref = {{ebicite|changed|EBI}}
-|  PubChem=92094
+| ChEMBL = 1451395
-|  ChEBI_Ref = {{ebicite|correct|EBI}}
+| PubChem = 92094
+| ChEBI_Ref = {{ebicite|correct|EBI}}
 | ChEBI = 47772
 | SMILES = Oc2cc(c1O[C@](CCc1c2)(C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)C
 }}
 |Section2={{Chembox Properties
-|  Formula=C<sub>27</sub>H<sub>46</sub>O<sub>2</sub>
+| Formula=C<sub>27</sub>H<sub>46</sub>O<sub>2</sub>
-|  MolarMass=402.65 g/mol
+| MolarMass=402.65 g/mol
-|  Appearance=
+| Appearance=
-|  Density=
+| Density=
-|  MeltingPt=
+| MeltingPt=
-|  BoilingPt=
+| BoilingPt=
-|  Solubility=
+| Solubility=
   }}
 |Section3={{Chembox Hazards
-|  MainHazards=
+| MainHazards=
-|  FlashPt=
+| FlashPt=
+| AutoignitionPt =
-|  Autoignition=
   }}
 }}
-'''δ-Tocopherol''' is one of the chemical [[Compound (chemistry)|compound]]s that is considered [[vitamin E]].  As a food additive, it has [[E number]] E309.
+'''δ-Tocopherol''' (''delta''-tocopherol) is a [[tocopherol]] and one of the [[chemical compound]]s that is considered [[vitamin E]].  As a [[food additive]], it has [[E number]] E309.<ref name="foodgov">{{cite web |title=Approved additives and E numbers |url=https://www.food.gov.uk/business-guidance/approved-additives-and-e-numbers |access-date=11 March 2022}}</ref>
-See the main article [[tocopherol]] for more information.
 ==See also==
-* [[Alpha-Tocopherol|''alpha''-Tocopherol]]
+* [[Alpha-Tocopherol]]
+* [[Beta-Tocopherol]]
-* [[Beta-Tocopherol|''beta''-Tocopherol]]
+* [[Gamma-Tocopherol]]
-* [[Gamma-Tocopherol|''gamma''-Tocopherol]]
 ==References==
@@ Line 58: / Line 59: @@
 {{Vitamin}}
-[[Category:Vitamins]]
+[[Category:Vitamin E]]
+[[Category:E-number additives]]
-[[fr:Delta-tocophérol]]