Jump to content

Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and 11-Hydroxy-THC: Difference between pages

(Difference between pages)
Page 1
Page 2
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 455739087 of page 11-Hydroxy-THC for the Chem/Drugbox validation project (updated: 'CAS_number').
 
No edit summary
 
Line 1: Line 1:
{{Short description|Active metabolite of Δ9-THC}}
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:11-Hydroxy-THC|oldid=455739087}} 455739087] of page [[11-Hydroxy-THC]] with values updated to verified values.}}
{{For|the isomer of this chemical inherited from [[Delta-8-tetrahydrocannabinol|Δ<sup>8</sup>-tetrahydrocannabinol]]|11-Hydroxy-Delta-8-THC}}
{{Drugbox
{{Infobox drug
| verifiedrevid = 451546660
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477208799
| IUPAC_name = (6''aR'',10''aR'')-9-(Hydroxymethyl)-6,6-dimethyl-3-pentyl- 6''a'',7,8,10''a''-tetrahydro-6''H''-benzo[''c'']chromen-1-ol
| IUPAC_name = (6''aR'',10''aR'')-9-(Hydroxymethyl)-6,6-dimethyl-3-pentyl- 6''a'',7,8,10''a''-tetrahydro-6''H''-benzo[''c'']chromen-1-ol
| image = 11-OH-THC.svg
| image = 11-OH-THC.svg
| width = 250px
| width = 250px
| image2 = 11-Hydroxy-THC-3D-balls.png
| alt2 = 11-Hydroxy-THC molecule


<!--Clinical data-->
<!--Clinical data-->
| tradename =
| tradename =
| legal_status =
| legal_status =
| legal_UK = Class B
| routes_of_administration =
| routes_of_administration =


<!--Pharmacokinetic data-->
<!--Pharmacokinetic data-->
| metabolism =
| metabolism =
| elimination_half-life =
| elimination_half-life =
| excretion =
| excretion =


<!--Identifiers-->
<!--Identifiers-->
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = <!-- blanked - oldvalue: 36557-05-8 -->
| CAS_number = 36557-05-8
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 9VY04N5SLB
| PubChem = 37482
| PubChem = 37482
| KEGG = C22778
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 34385
| ChemSpiderID = 34385
| class = [[Cannabinoid]]


<!--Chemical data-->
<!--Chemical data-->
| C=21 | H=30 | O=3
| C=21 | H=30 | O=3
| molecular_weight = 330.461 g/mol
| smiles = Oc2cc(cc1OC(C3CC/C(=C\C3c12)CO)(C)C)CCCCC
| smiles = Oc2cc(cc1OC(C3CC/C(=C\C3c12)CO)(C)C)CCCCC
| InChI = 1/C21H30O3/c1-4-5-6-7-14-11-18(23)20-16-10-15(13-22)8-9-17(16)21(2,3)24-19(20)12-14/h10-12,16-17,22-23H,4-9,13H2,1-3H3
| InChIKey = YCBKSSAWEUDACY-UHFFFAOYAL
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C21H30O3/c1-4-5-6-7-14-11-18(23)20-16-10-15(13-22)8-9-17(16)21(2,3)24-19(20)12-14/h10-12,16-17,22-23H,4-9,13H2,1-3H3
| StdInChI = 1S/C21H30O3/c1-4-5-6-7-14-11-18(23)20-16-10-15(13-22)8-9-17(16)21(2,3)24-19(20)12-14/h10-12,16-17,22-23H,4-9,13H2,1-3H3
Line 33: Line 41:
| StdInChIKey = YCBKSSAWEUDACY-UHFFFAOYSA-N
| StdInChIKey = YCBKSSAWEUDACY-UHFFFAOYSA-N
}}
}}

'''11-Hydroxy-Δ<sup>9</sup>-tetrahydrocannabinol''' ('''11-OH-Δ<sup>9</sup>-THC''', alternatively numbered as '''7-OH-Δ<sup>1</sup>-THC'''), usually referred to as '''11-hydroxy-THC''' is the main active [[metabolite]] of [[tetrahydrocannabinol]] (THC), which is formed in the body after Δ<sup>9</sup>-THC is consumed.<ref name=Kraemer2007>{{cite journal | vauthors = Kraemer T, Paul LD | title = Bioanalytical procedures for determination of drugs of abuse in blood | journal = Analytical and Bioanalytical Chemistry | volume = 388 | issue = 7 | pages = 1415–1435 | date = August 2007 | pmid = 17468860 | doi = 10.1007/s00216-007-1271-6 | s2cid = 32917584 }}</ref><ref name=Huestis2005>{{cite book | vauthors = Huestis MA | title = Cannabinoids | chapter = Pharmacokinetics and metabolism of the plant cannabinoids, delta9-tetrahydrocannabinol, cannabidiol and cannabinol | series = Handbook of Experimental Pharmacology | volume = 168 | pages = 657–690 | date = 2005 | issue = <!-- none --> | pmid = 16596792 | doi = 10.1007/3-540-26573-2_23 | isbn = 3-540-22565-X }}</ref>

After [[cannabis consumption]], THC is [[hydroxylation|metabolized]] inside the body by [[cytochrome P450]] enzymes such as [[CYP2C9]] and [[CYP3A4]] into 11-hydroxy-THC and then further metabolized by [[dehydrogenase]] {{which|date=April 2024}} and [[CYP2C9]] enzymes to form [[11-nor-9-carboxy-THC]] (THC-COOH) which is inactive at the CB<sub>1</sub> receptors;<ref name=Huestis2005/> and further [[Glucuronidation|glucuronidated]] to form 11-nor-Δ<sup>9</sup>-tetrahydrocannabinol-9-carboxylic acid glucuronide (Δ<sup>9</sup>-THC-COOH-glu)<ref name="Stout_2014">{{cite journal | vauthors = Stout SM, Cimino NM | title = Exogenous cannabinoids as substrates, inhibitors, and inducers of human drug metabolizing enzymes: a systematic review | journal = Drug Metabolism Reviews | volume = 46 | issue = 1 | pages = 86–95 | date = February 2014 | pmid = 24160757 | doi = 10.3109/03602532.2013.849268 | s2cid = 29133059 | url = https://zenodo.org/record/1093138 }}</ref> in the liver, from where it is subsequently excreted through feces and urine (via [[bile]] from the liver).<ref name="Grotenhermen_2003">{{cite journal | vauthors = Grotenhermen F | title = Pharmacokinetics and pharmacodynamics of cannabinoids | journal = Clinical Pharmacokinetics | volume = 42 | issue = 4 | pages = 327–360 | date = 2003 | pmid = 12648025 | doi = 10.2165/00003088-200342040-00003 | s2cid = 25623600 }}</ref> Both metabolites, along with THC, can be assayed in drug tests.<ref name=Kraemer2007/>

11-hydroxy-THC can be formed after consumption of THC from inhalation (vaping, smoking) and oral (by mouth, edible, sublingual) use, although levels of 11-hydroxy-THC are typically higher when eaten compared to inhalation.<ref name="Huestis_1992">{{cite journal | vauthors = Huestis MA, Henningfield JE, Cone EJ | title = Blood cannabinoids. I. Absorption of THC and formation of 11-OH-THC and THCCOOH during and after smoking marijuana | journal = Journal of Analytical Toxicology | volume = 16 | issue = 5 | pages = 276–282 | date = 1992 | pmid = 1338215 | doi = 10.1093/jat/16.5.276 }}</ref><ref name="Karschner_2009">{{cite journal | vauthors = Karschner EL, Schwilke EW, Lowe RH, Darwin WD, Herning RI, Cadet JL, Huestis MA | title = Implications of plasma Delta9-tetrahydrocannabinol, 11-hydroxy-THC, and 11-nor-9-carboxy-THC concentrations in chronic cannabis smokers | journal = Journal of Analytical Toxicology | volume = 33 | issue = 8 | pages = 469–477 | date = October 2009 | pmid = 19874654 | pmc = 3159863 | doi = 10.1093/jat/33.8.469 }}</ref>

== Pharmacology ==
Like Δ<sup>9</sup>-THC, 11-hydroxy-THC is a partial agonist at the [[cannabinoid receptor]] [[Cannabinoid receptor type 1|CB<sub>1</sub>]], but with significantly higher [[Ligand (biochemistry)#Receptor/ligand binding affinity|binding affinity]] (K<sub>i</sub> = 0.37&nbsp;nM compared to Δ<sup>9</sup>-THC K<sub>i</sub> = 35&nbsp;nM).<ref name="Zagzoog2022">{{cite journal | vauthors = Zagzoog A, Cabecinha A, Abramovici H, Laprairie RB | title = Modulation of type 1 cannabinoid receptor activity by cannabinoid by-products from ''Cannabis sativa'' and non-cannabis phytomolecules | journal = Frontiers in Pharmacology | volume = 13 | pages = 956030 | date = 26 August 2022 | pmid = 36091813 | doi = 10.3389/fphar.2022.956030 | pmc = 9458935 | doi-access = free }}</ref> With respect to [[Cyclic adenosine monophosphate|cAMP]] inhibition at CB<sub>1</sub> it displays a similar efficacy to that of Δ<sup>9</sup>-THC (EC<sub>50</sub> = 11&nbsp;nM vs. EC<sub>50</sub> = 5.2&nbsp;nM, respectively), but a lower maximum response (E<sub>max</sub> = 28% vs. E<sub>max</sub> = 70%).<ref name="Zagzoog2022" />

== Research ==
In an ''[[in vitro]]'' analysis by the [[University of Rhode Island]] on [[cannabinoids]] it was found that 11-OH-Δ<sup>9</sup>-THC had the 3rd highest [[3C-like protease]] inhibitor activity against [[COVID-19]] out of all the cannabinoids tested within that study but not as high as the [[antiviral drug]] [[GC376]] (56% for 11-OH-Δ<sup>9</sup>-THC vs. 100% for GC376).<ref>{{cite journal | vauthors = Liu C, Puopolo T, Li H, Cai A, Seeram NP, Ma H | title = Identification of SARS-CoV-2 Main Protease Inhibitors from a Library of Minor Cannabinoids by Biochemical Inhibition Assay and Surface Plasmon Resonance Characterized Binding Affinity | journal = Molecules | volume = 27 | issue = 18 | page = 6127 | date = September 2022 | pmid = 36144858 | pmc = 9502466 | doi = 10.3390/molecules27186127 | doi-access = free }}</ref>

== See also ==
* [[11-Hydroxy-Delta-8-THC]]
* [[11-Hydroxyhexahydrocannabinol]]
* [[3'-Hydroxy-THC]]
* [[7-Hydroxycannabidiol]]
* [[8,11-Dihydroxytetrahydrocannabinol]]
* [[11-OH-CBN]]
* [[Cannabis edible]]
* [[Delta-11-Tetrahydrocannabinol]]

== References ==
{{reflist}}

{{Cannabinoids}}
{{Cannabinoidergics}}

{{DEFAULTSORT:Hydroxy-THC, 11-}}
[[Category:Cannabinoids]]
[[Category:Benzochromenes]]
[[Category:Primary alcohols]]
[[Category:Phenols]]
[[Category:Diols]]
[[Category:Recreational drug metabolites]]