Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and 11-Hydroxy-THC: Difference between pages
Appearance
(Difference between pages)
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 455739087 of page 11-Hydroxy-THC for the Chem/Drugbox validation project (updated: 'CAS_number'). |
No edit summary |
||
Line 1: | Line 1: | ||
{{Short description|Active metabolite of Δ9-THC}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:11-Hydroxy-THC|oldid=455739087}} 455739087] of page [[11-Hydroxy-THC]] with values updated to verified values.}} |
|||
{{For|the isomer of this chemical inherited from [[Delta-8-tetrahydrocannabinol|Δ<sup>8</sup>-tetrahydrocannabinol]]|11-Hydroxy-Delta-8-THC}} |
|||
{{Drugbox |
|||
{{Infobox drug |
|||
⚫ | |||
| Verifiedfields = changed |
|||
| Watchedfields = changed |
|||
⚫ | |||
| IUPAC_name = (6''aR'',10''aR'')-9-(Hydroxymethyl)-6,6-dimethyl-3-pentyl- 6''a'',7,8,10''a''-tetrahydro-6''H''-benzo[''c'']chromen-1-ol |
| IUPAC_name = (6''aR'',10''aR'')-9-(Hydroxymethyl)-6,6-dimethyl-3-pentyl- 6''a'',7,8,10''a''-tetrahydro-6''H''-benzo[''c'']chromen-1-ol |
||
| image = 11-OH-THC.svg |
| image = 11-OH-THC.svg |
||
| width = 250px |
| width = 250px |
||
| image2 = 11-Hydroxy-THC-3D-balls.png |
|||
| alt2 = 11-Hydroxy-THC molecule |
|||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = |
||
| legal_status = |
| legal_status = |
||
| legal_UK = Class B |
|||
| routes_of_administration = |
| routes_of_administration = |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| metabolism = |
| metabolism = |
||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite|changed|??}} |
|||
| CAS_number = |
| CAS_number = 36557-05-8 |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| UNII = 9VY04N5SLB |
|||
| PubChem = 37482 |
| PubChem = 37482 |
||
| KEGG = C22778 |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 34385 |
| ChemSpiderID = 34385 |
||
| class = [[Cannabinoid]] |
|||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=21 | H=30 | O=3 |
| C=21 | H=30 | O=3 |
||
| molecular_weight = 330.461 g/mol |
|||
| smiles = Oc2cc(cc1OC(C3CC/C(=C\C3c12)CO)(C)C)CCCCC |
| smiles = Oc2cc(cc1OC(C3CC/C(=C\C3c12)CO)(C)C)CCCCC |
||
| InChI = 1/C21H30O3/c1-4-5-6-7-14-11-18(23)20-16-10-15(13-22)8-9-17(16)21(2,3)24-19(20)12-14/h10-12,16-17,22-23H,4-9,13H2,1-3H3 |
|||
| InChIKey = YCBKSSAWEUDACY-UHFFFAOYAL |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C21H30O3/c1-4-5-6-7-14-11-18(23)20-16-10-15(13-22)8-9-17(16)21(2,3)24-19(20)12-14/h10-12,16-17,22-23H,4-9,13H2,1-3H3 |
| StdInChI = 1S/C21H30O3/c1-4-5-6-7-14-11-18(23)20-16-10-15(13-22)8-9-17(16)21(2,3)24-19(20)12-14/h10-12,16-17,22-23H,4-9,13H2,1-3H3 |
||
Line 33: | Line 41: | ||
| StdInChIKey = YCBKSSAWEUDACY-UHFFFAOYSA-N |
| StdInChIKey = YCBKSSAWEUDACY-UHFFFAOYSA-N |
||
}} |
}} |
||
'''11-Hydroxy-Δ<sup>9</sup>-tetrahydrocannabinol''' ('''11-OH-Δ<sup>9</sup>-THC''', alternatively numbered as '''7-OH-Δ<sup>1</sup>-THC'''), usually referred to as '''11-hydroxy-THC''' is the main active [[metabolite]] of [[tetrahydrocannabinol]] (THC), which is formed in the body after Δ<sup>9</sup>-THC is consumed.<ref name=Kraemer2007>{{cite journal | vauthors = Kraemer T, Paul LD | title = Bioanalytical procedures for determination of drugs of abuse in blood | journal = Analytical and Bioanalytical Chemistry | volume = 388 | issue = 7 | pages = 1415–1435 | date = August 2007 | pmid = 17468860 | doi = 10.1007/s00216-007-1271-6 | s2cid = 32917584 }}</ref><ref name=Huestis2005>{{cite book | vauthors = Huestis MA | title = Cannabinoids | chapter = Pharmacokinetics and metabolism of the plant cannabinoids, delta9-tetrahydrocannabinol, cannabidiol and cannabinol | series = Handbook of Experimental Pharmacology | volume = 168 | pages = 657–690 | date = 2005 | issue = <!-- none --> | pmid = 16596792 | doi = 10.1007/3-540-26573-2_23 | isbn = 3-540-22565-X }}</ref> |
|||
After [[cannabis consumption]], THC is [[hydroxylation|metabolized]] inside the body by [[cytochrome P450]] enzymes such as [[CYP2C9]] and [[CYP3A4]] into 11-hydroxy-THC and then further metabolized by [[dehydrogenase]] {{which|date=April 2024}} and [[CYP2C9]] enzymes to form [[11-nor-9-carboxy-THC]] (THC-COOH) which is inactive at the CB<sub>1</sub> receptors;<ref name=Huestis2005/> and further [[Glucuronidation|glucuronidated]] to form 11-nor-Δ<sup>9</sup>-tetrahydrocannabinol-9-carboxylic acid glucuronide (Δ<sup>9</sup>-THC-COOH-glu)<ref name="Stout_2014">{{cite journal | vauthors = Stout SM, Cimino NM | title = Exogenous cannabinoids as substrates, inhibitors, and inducers of human drug metabolizing enzymes: a systematic review | journal = Drug Metabolism Reviews | volume = 46 | issue = 1 | pages = 86–95 | date = February 2014 | pmid = 24160757 | doi = 10.3109/03602532.2013.849268 | s2cid = 29133059 | url = https://zenodo.org/record/1093138 }}</ref> in the liver, from where it is subsequently excreted through feces and urine (via [[bile]] from the liver).<ref name="Grotenhermen_2003">{{cite journal | vauthors = Grotenhermen F | title = Pharmacokinetics and pharmacodynamics of cannabinoids | journal = Clinical Pharmacokinetics | volume = 42 | issue = 4 | pages = 327–360 | date = 2003 | pmid = 12648025 | doi = 10.2165/00003088-200342040-00003 | s2cid = 25623600 }}</ref> Both metabolites, along with THC, can be assayed in drug tests.<ref name=Kraemer2007/> |
|||
11-hydroxy-THC can be formed after consumption of THC from inhalation (vaping, smoking) and oral (by mouth, edible, sublingual) use, although levels of 11-hydroxy-THC are typically higher when eaten compared to inhalation.<ref name="Huestis_1992">{{cite journal | vauthors = Huestis MA, Henningfield JE, Cone EJ | title = Blood cannabinoids. I. Absorption of THC and formation of 11-OH-THC and THCCOOH during and after smoking marijuana | journal = Journal of Analytical Toxicology | volume = 16 | issue = 5 | pages = 276–282 | date = 1992 | pmid = 1338215 | doi = 10.1093/jat/16.5.276 }}</ref><ref name="Karschner_2009">{{cite journal | vauthors = Karschner EL, Schwilke EW, Lowe RH, Darwin WD, Herning RI, Cadet JL, Huestis MA | title = Implications of plasma Delta9-tetrahydrocannabinol, 11-hydroxy-THC, and 11-nor-9-carboxy-THC concentrations in chronic cannabis smokers | journal = Journal of Analytical Toxicology | volume = 33 | issue = 8 | pages = 469–477 | date = October 2009 | pmid = 19874654 | pmc = 3159863 | doi = 10.1093/jat/33.8.469 }}</ref> |
|||
== Pharmacology == |
|||
Like Δ<sup>9</sup>-THC, 11-hydroxy-THC is a partial agonist at the [[cannabinoid receptor]] [[Cannabinoid receptor type 1|CB<sub>1</sub>]], but with significantly higher [[Ligand (biochemistry)#Receptor/ligand binding affinity|binding affinity]] (K<sub>i</sub> = 0.37 nM compared to Δ<sup>9</sup>-THC K<sub>i</sub> = 35 nM).<ref name="Zagzoog2022">{{cite journal | vauthors = Zagzoog A, Cabecinha A, Abramovici H, Laprairie RB | title = Modulation of type 1 cannabinoid receptor activity by cannabinoid by-products from ''Cannabis sativa'' and non-cannabis phytomolecules | journal = Frontiers in Pharmacology | volume = 13 | pages = 956030 | date = 26 August 2022 | pmid = 36091813 | doi = 10.3389/fphar.2022.956030 | pmc = 9458935 | doi-access = free }}</ref> With respect to [[Cyclic adenosine monophosphate|cAMP]] inhibition at CB<sub>1</sub> it displays a similar efficacy to that of Δ<sup>9</sup>-THC (EC<sub>50</sub> = 11 nM vs. EC<sub>50</sub> = 5.2 nM, respectively), but a lower maximum response (E<sub>max</sub> = 28% vs. E<sub>max</sub> = 70%).<ref name="Zagzoog2022" /> |
|||
== Research == |
|||
In an ''[[in vitro]]'' analysis by the [[University of Rhode Island]] on [[cannabinoids]] it was found that 11-OH-Δ<sup>9</sup>-THC had the 3rd highest [[3C-like protease]] inhibitor activity against [[COVID-19]] out of all the cannabinoids tested within that study but not as high as the [[antiviral drug]] [[GC376]] (56% for 11-OH-Δ<sup>9</sup>-THC vs. 100% for GC376).<ref>{{cite journal | vauthors = Liu C, Puopolo T, Li H, Cai A, Seeram NP, Ma H | title = Identification of SARS-CoV-2 Main Protease Inhibitors from a Library of Minor Cannabinoids by Biochemical Inhibition Assay and Surface Plasmon Resonance Characterized Binding Affinity | journal = Molecules | volume = 27 | issue = 18 | page = 6127 | date = September 2022 | pmid = 36144858 | pmc = 9502466 | doi = 10.3390/molecules27186127 | doi-access = free }}</ref> |
|||
== See also == |
|||
* [[11-Hydroxy-Delta-8-THC]] |
|||
* [[11-Hydroxyhexahydrocannabinol]] |
|||
* [[3'-Hydroxy-THC]] |
|||
* [[7-Hydroxycannabidiol]] |
|||
* [[8,11-Dihydroxytetrahydrocannabinol]] |
|||
* [[11-OH-CBN]] |
|||
* [[Cannabis edible]] |
|||
* [[Delta-11-Tetrahydrocannabinol]] |
|||
== References == |
|||
{{reflist}} |
|||
{{Cannabinoids}} |
|||
{{Cannabinoidergics}} |
|||
{{DEFAULTSORT:Hydroxy-THC, 11-}} |
|||
[[Category:Cannabinoids]] |
|||
[[Category:Benzochromenes]] |
|||
[[Category:Primary alcohols]] |
|||
[[Category:Phenols]] |
|||
[[Category:Diols]] |
|||
[[Category:Recreational drug metabolites]] |