Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Adatanserin: Difference between pages
Appearance
(Difference between pages)
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 454436672 of page Adatanserin for the Chem/Drugbox validation project (updated: 'CAS_number'). |
m Check drugbox IDs |
||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Adatanserin|oldid=454436672}} 454436672] of page [[Adatanserin]] with values updated to verified values.}} |
|||
{{Drugbox |
{{Drugbox |
||
| verifiedrevid = 451553917 |
|||
| IUPAC_name = ''N''-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]adamantane-1-carboxamide |
| IUPAC_name = ''N''-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]adamantane-1-carboxamide |
||
| image = Adatanserin. |
| image = Adatanserin.svg |
||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = |
||
| pregnancy_category = |
| pregnancy_category = |
||
| legal_status = |
| legal_status = |
||
| routes_of_administration = |
| routes_of_administration = |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| bioavailability = |
| bioavailability = |
||
| metabolism = |
| metabolism = |
||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite|correct|CAS}} |
|||
| CAS_number = |
| CAS_number = 127266-56-2 |
||
| ATC_prefix = none |
| ATC_prefix = none |
||
| ATC_suffix = |
| ATC_suffix = |
||
| PubChem = 130918 |
| PubChem = 130918 |
||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|||
| ChEMBL = 2107510 |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 115774 |
| ChemSpiderID = 115774 |
||
Line 28: | Line 30: | ||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=21 | H=31 | N=5 | O=1 |
| C=21 | H=31 | N=5 | O=1 |
||
| molecular_weight = 369.50 g/mol |
|||
| smiles = O=C(NCCN2CCN(c1ncccn1)CC2)C35CC4CC(CC(C3)C4)C5 |
| smiles = O=C(NCCN2CCN(c1ncccn1)CC2)C35CC4CC(CC(C3)C4)C5 |
||
| InChI = 1/C21H31N5O/c27-19(21-13-16-10-17(14-21)12-18(11-16)15-21)22-4-5-25-6-8-26(9-7-25)20-23-2-1-3-24-20/h1-3,16-18H,4-15H2,(H,22,27) |
|||
| InChIKey = HPFLVTSWRFCPCV-UHFFFAOYAT |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C21H31N5O/c27-19(21-13-16-10-17(14-21)12-18(11-16)15-21)22-4-5-25-6-8-26(9-7-25)20-23-2-1-3-24-20/h1-3,16-18H,4-15H2,(H,22,27) |
| StdInChI = 1S/C21H31N5O/c27-19(21-13-16-10-17(14-21)12-18(11-16)15-21)22-4-5-25-6-8-26(9-7-25)20-23-2-1-3-24-20/h1-3,16-18H,4-15H2,(H,22,27) |
||
Line 38: | Line 37: | ||
| StdInChIKey = HPFLVTSWRFCPCV-UHFFFAOYSA-N |
| StdInChIKey = HPFLVTSWRFCPCV-UHFFFAOYSA-N |
||
}} |
}} |
||
'''Adatanserin''' ('''WY-50,324''', '''SEB-324''') is a mixed [[5-HT1A receptor|5-HT<sub>1A</sub> receptor]] [[partial agonist]] and [[5-HT2A receptor|5-HT<sub>2A</sub>]] and [[5-HT2C receptor|5-HT<sub>2C</sub> receptor]] [[receptor antagonist|antagonist]].<ref name="pmid8497336">{{cite journal |vauthors=Singh A, Lucki I | title = Antidepressant-like activity of compounds with varying efficacy at 5-HT1A receptors | journal = Neuropharmacology | volume = 32 | issue = 4 | pages = 331–40 |date=April 1993| pmid = 8497336 | doi = 10.1016/0028-3908(93)90153-T| s2cid = 38611829 }}</ref><ref name="pmid8632301">{{cite journal |vauthors=Kleven MS, Koek W | title = Pharmacological characterization of in vivo properties of putative mixed 5-HT1A agonist/5-HT2A/2C antagonist anxiolytics. I. Antipunishment effects in the pigeon | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 276 | issue = 2 | pages = 388–97 |date=February 1996| pmid = 8632301 | url = http://jpet.aspetjournals.org/cgi/pmidlookup?view=long&pmid=8632301}}</ref><ref name="pmid10602693">{{cite journal |vauthors=Abou-Gharbia MA, Childers WE, Fletcher H | title = Synthesis and SAR of adatanserin: novel adamantyl aryl- and heteroarylpiperazines with dual serotonin 5-HT(1A) and 5-HT(2) activity as potential anxiolytic and antidepressant agents | journal = Journal of Medicinal Chemistry | volume = 42 | issue = 25 | pages = 5077–94 |date=December 1999| pmid = 10602693 | doi = 10.1021/jm9806704|display-authors=etal}}</ref> It was under development by [[Wyeth]] as an [[antidepressant]] but was ultimately not pursued.<ref name="pmid10602693"/><ref name="isbn0-521-64615-4">{{cite book | author = Stahl, S. M. | title = Essential psychopharmacology: neuroscientific basis and practical application | publisher = Cambridge University Press | location = Cambridge, UK | year = 2000 | isbn = 0-521-64615-4 | url = https://archive.org/details/essentialpsychop00step| url-access = registration | page = [https://archive.org/details/essentialpsychop00step/page/262 262] | quote = adatanserin. }}</ref> |
|||
Adantaserin has been shown to be [[neuroprotective]] against [[ischemia]]-induced [[glutamatergic]] [[excitotoxicity]], an effect which appears to be mediated by blockade of the 5-HT<sub>2A</sub> receptor.<ref name="pmid11741003">{{cite journal |vauthors=Dawson LA, Galandak J, Djali S | title = Attenuation of ischemic efflux of endogenous amino acids by the novel 5-HT(1A)/5-HT(2) receptor ligand adatanserin | journal = Neurochemistry International | volume = 40 | issue = 3 | pages = 203–9 |date=March 2002| pmid = 11741003 | doi = 10.1016/S0197-0186(01)00082-1| s2cid = 24104458 }}</ref> |
|||
==Synthesis== |
|||
:[[File:Adatanserin synthesis.svg|upright=2]] |
|||
2-Chloropyrimidine (1) reacts with [[piperazine]] (2), forming 2-(1-piperazinyl)pyrimidine (3). Treatment with the [[phthalimide]] derivative N-(2-bromoethyl)phthalimide (4) in an [[alkylation]] reaction produces (5), which is [[protecting group|deprotected]] using [[hydrazine]] to give the [[primary amine]] (6). [[Amide]] formation with the [[acid chloride]] of [[1-Adamantanecarboxylic acid|1-adamantanecarboxylic acid]] yields adatanserin.<ref>{{cite patent |country=US |number=5482940 |inventor=Magid A.-M., et al. |title=Use of aryl- and heteroaryl piperazinyl carboxamides in the treatment of various central nervous system disorders |status=patent |gdate=1996-01-09 |fdate=1993-04-19 |pridate=1990-03-14 |assign1=American Home Products Corp}}</ref><ref name="pmid10602693"/> |
|||
==See also== |
|||
* [[Flibanserin]] |
|||
==References== |
|||
{{Reflist}} |
|||
{{Serotonergics}} |
|||
{{Piperazines}} |
|||
[[Category:5-HT1A agonists]] |
|||
[[Category:5-HT2A antagonists]] |
|||
[[Category:5-HT2C antagonists]] |
|||
[[Category:Abandoned drugs]] |
|||
[[Category:Adamantanes]] |
|||
[[Category:Carboxamides]] |
|||
[[Category:Piperazines]] |
|||
[[Category:Aminopyrimidines]] |
|||
{{nervous-system-drug-stub}} |