Jump to content

Apiforol: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
mNo edit summary
Citation bot (talk | contribs)
Bots
5,018,826 edits
Alter: pmc. Add: doi-access, page, authors 1-1. Removed proxy/dead URL that duplicated identifier. Removed parameters. Some additions/deletions were parameter name changes. | Use this bot. Report bugs. | Suggested by GoingBatty | Category:CS1 maint: PMC format | #UCB_Category
 
(13 intermediate revisions by 12 users not shown)
Line 1: Line 1:
{{chembox
{{chembox
| Verifiedfields = changed
⚫
| verifiedrevid = 399510638
| Watchedfields = changed
| Name = Apiforol
⚫
| verifiedrevid = 423598849
| ImageFile = Apiforol.PNG
| ImageSize = 200px
| Name = Apiforol
| ImageName = Chemical structure of Apiforol.
| ImageFile = Apiforol.svg
| ImageSize = 200px
⚫
| IUPACName = (2S)-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-4,5,7-triol
| ImageName = Chemical structure of Apiforol.
⚫
| Section1 = {{Chembox Identifiers
⚫
| IUPACName = (2''S'')-2-(4-Hydroxyphenyl)-3,4-dihydro-2''H''-chromene-4,5,7-triol
⚫
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫
|Section1={{Chembox Identifiers
⚫
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 391780
| ChemSpiderID = 391780
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
Line 14: Line 16:
| StdInChIKey = RPKUCYSGAXIESU-ABLWVSNPSA-N
| StdInChIKey = RPKUCYSGAXIESU-ABLWVSNPSA-N
| SMILES1 = Oc1ccc(cc1)[C@H]3Oc2cc(O)cc(O)c2C(O)C3
| SMILES1 = Oc1ccc(cc1)[C@H]3Oc2cc(O)cc(O)c2C(O)C3
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 55167-29-8
| CASNo = 55167-29-8
| ChEBI_Ref = {{ebicite|changed|EBI}}
⚫
| PubChem = 443638
| ChEBI = 74812
⚫
| SMILES = C1C(C2=C(C=C(C=C2OC1C3=CC=C(C=C3)O)O)O)O
⚫
| PubChem = 443638
| KEGG = C12124
⚫
| SMILES = C1C(C2=C(C=C(C=C2OC1C3=CC=C(C=C3)O)O)O)O
}}
}}
| Section2 = {{Chembox Properties
|Section2={{Chembox Properties
| C=15 | H=14 | O=5
| Formula = C<sub>15</sub>H<sub>14</sub>O<sub>5</sub>
⚫
| Density = <!-- g/cm<sup>3</sup> -->
| MolarMass = 274.26 g/mol
⚫
| MeltingPt = <!-- °C -->
| ExactMass = 274.084124
⚫
| BoilingPt =
⚫
| Density = <!-- g/cm<sup>3</sup> -->
⚫
| MeltingPt = <!-- °C -->
⚫
| BoilingPt =
}}
}}
}}
}}

'''Apiforol''' is a chemical compound belonging to the [[flavan-4ol]] class of flavonoids.
'''Apiforol''' is a chemical compound belonging to the [[flavan-4ol]] class of flavonoids.


==Metabolism==
==Metabolism==
(2S)-flavan-4-ol:NADP+ 4-oxidoreductase ([[flavanone 4-reductase]]<ref name="brenda-enzymes">[http://www.brenda-enzymes.org/php/result_flat.php4?ecno=1.1.1.234 EC 1.1.1.234 - flavanone 4-reductase on brenda-enzymes.org]</ref>) is an enzyme transforming [[Naringenin]] into apiforol<ref>[http://nashua.case.edu/PathwaysKegg/Web/?viewID=ff65148c-8581-4b7b-b4d8-8992029c4e04&pwgid=92e3f03e-9433-4b3e-a82c-3d82d40c45a4 Apiforol on nashua.case.edu]</ref>. This enzyme can be found in ''[[Columnea hybrida]]'', in ''[[Malus domestica]]'', in ''[[Pyrus communis]]'', in ''[[Sinningia cardinalis]]'', and in ''[[Zea mays]]''<ref name="brenda-enzymes"/>.
[[Flavanone 4-reductase]]<ref name="brenda-enzymes">[http://www.brenda-enzymes.org/php/result_flat.php4?ecno=1.1.1.234 EC 1.1.1.234 - flavanone 4-reductase on brenda-enzymes.org]</ref> is an enzyme transforming [[naringenin]] into apiforol.<ref>{{Cite journal |last1=Mizuno |first1=Hiroshi |last2=Yazawa |first2=Takayuki |last3=Kasuga |first3=Shigemitsu |last4=Sawada |first4=Yuji |last5=Kanamori |first5=Hiroyuki |last6=Ogo |first6=Yuko |last7=Hirai |first7=Masami Yokota |last8=Matsumoto |first8=Takashi |last9=Kawahigashi |first9=Hiroyuki |date=2016 |title=Expression of Flavone Synthase II and Flavonoid 3′-Hydroxylase Is Associated with Color Variation in Tan-Colored Injured Leaves of Sorghum |journal=Frontiers in Plant Science |volume=7 |page=1718 |doi=10.3389/fpls.2016.01718 |doi-access=free |issn=1664-462X |pmc=5116553 |pmid=27917182}}</ref> This enzyme can be found in ''[[Columnea hybrida]]'', in ''[[Malus domestica]]'', in ''[[Pyrus communis]]'', in ''[[Sinningia cardinalis]]'', and in ''[[Zea mays]]''.<ref name="brenda-enzymes"/>


==References==
==References==
Line 37: Line 42:
{{Flavan-4ol}}
{{Flavan-4ol}}


[[Category:Flavan-4ols]]
[[Category:Flavan-4-ols]]
[[Category:Resorcinols]]
[[Category:Resorcinols]]




{{Natural-phenol-stub}}
{{phenol-stub}}
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"