Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Calcium iodate: Difference between pages

{{One source|date=November 2023}}

| Verifiedfields = changed

| verifiedrevid = 476998750

| ImageSize =

| OtherNames = Lautarite

|Section1={{Chembox Identifiers

| InChI = 1/Ca.2HIO3/c;2*2-1(3)4/h;2*(H,2,3,4)/q+2;;/p-2

| SMILES = [Ca+2].[O-]I(=O)=O.[O-]I(=O)=O

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 7789-80-2

| CASNo_Comment = (anhydrous)

| CASNo2_Ref = {{cascite|changed|??}}

| CASNo2 = 10031-33-1

| CASNo2_Comment = (hexahydrate)

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = L8MN4Y57BR

| UNII_Comment = (anhydrous)

| EC_number = 232-191-3

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| PubChem = 24619

|Section2={{Chembox Properties

| Formula = Ca(IO₃)₂

| MolarMass = 389.88 g/mol (anhydrous)<br />407.90 g/mol (monohydrate)

| Appearance = white solid

| Density = 4.519 g/cm³ (monohydrate)

| MeltingPtC = 540

| MeltingPt_notes = (monohydrate)

| BoilingPt = decomposes

| Solubility = 0.09 g/100 mL (0 °C) <br> 0.24 g/100 mL (20 °C) <br> 0.67 g/100 mL (90 °C)

| SolubilityProduct = 6.47{{e|-6}}

| SolubleOther = soluble in [[nitric acid]] <br> insoluble in [[ethanol|alcohol]]

| MagSus = -101.4·10⁻⁶ cm³/mol }}

|Section3={{Chembox Structure

| CrystalStruct = monoclinic (anhydrous) <br> cubic (monohydrate) <br> orthorhombic (hexahydrate)

|Section7={{Chembox Hazards

| FlashPt = non-flammable

'''Calcium iodate''' is any of two [[inorganic compound]]s with the formula Ca(IO₃)₂(H₂O)_x, where x = 0 or 1. Both are colourless salts that occur as the minerals [[lautarite]] and [[bruggenite]], respectively. A third mineral form of calcium iodate is [[dietzeite]], a salt containing [[Monochromate|chromate]] with the formula Ca₂(IO₃)₂CrO₄.<ref name=Ullmann>{{Ullmann |doi=10.1002/14356007.a14_381.pub2 |title=Iodine and Iodine Compounds |year=2015 |last1=Lyday |first1=Phyllis A. |last2=Kaiho |first2=Tatsuo |pages=1–13 }}</ref> These minerals are the most common compounds containing [[iodate]].

==Production and uses==

Lautarite, described as ''the'' most important mineral source of iodine, is mined in the [[Atacama Desert]].<ref name=Ullmann/> Processing of the ore entails reduction of its aqueous extracts with [[sodium bisulfite]] to give [[sodium iodide]]. This [[Comproportionation|comproportionation reaction]] is a major source of the sodium iodide.<ref name=Ullmann/>

Calcium iodate can be produced by the anodic oxidation of [[calcium iodide]] or by passing [[chlorine]] into a hot solution of lime in which [[iodine]] has been dissolved.

Calcium iodate is used as an iodine supplement in [[chicken feed]].<ref name=Ullmann/> [[Ethylenediamine dihydroiodide]] (EDDI) is a more typical source of nutritional [[iodine]].

==References==

{{reflist}}

{{Calcium compounds}}

{{Iodates}}

[[Category:Antiseptics]]

[[Category:Calcium compounds]]

[[Category:Iodates]]

[[Category:Oxidizing agents]]