Jump to content

Carbuterol: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
CheMoBot (talk | contribs)
Bots
141,565 edits
Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wikipedia talk:WikiProject_Pharm
Importing Wikidata short description: "Chemical compound" (Shortdesc helper)
 
(38 intermediate revisions by 23 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{drugbox
{{Drugbox
⚫
| UNII_Ref = {{fdacite|correct|FDA}}
| Verifiedfields = changed
⚫
| UNII = 0N12JR32MR
| verifiedrevid = 443485796
| verifiedrevid = 443941802
⚫
| IUPAC_name = (''RS'')-<nowiki/>{5-[2-(tert-butylamino)-1-hydroxyethyl]-2-hydroxyphenyl}urea
| drug_name = Carbuterol
| image = Carbuterol.svg
⚫
| IUPAC_name = (''RS'')-{5-[2-(tert-butylamino)-1-hydroxyethyl]-2-hydroxyphenyl}urea
| image = Carbuterol.svg
| width = 230
| chirality = [[Racemic mixture]]
| imagename = 1 : 1 mixture (racemate)

| width = 200px
<!--Clinical data-->| tradename =
⚫
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫
| ChemSpiderID = 33928
| pregnancy_US = <!-- A / B / C / D / X -->
⚫
| InChI = 1/C13H21N3O3/c1-13(2,3)15-7-11(18)8-4-5-10(17)9(6-8)16-12(14)19/h4-6,11,15,17-18H,7H2,1-3H3,(H3,14,16,19)
⚫
| pregnancy_category =
⚫
| smiles = O=C(Nc1cc(ccc1O)C(O)CNC(C)(C)C)N
⚫
| legal_AU = S4
| InChIKey = KEMXXQOFIRIICG-UHFFFAOYAD
⚫
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
⚫
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| StdInChI = 1S/C13H21N3O3/c1-13(2,3)15-7-11(18)8-4-5-10(17)9(6-8)16-12(14)19/h4-6,11,15,17-18H,7H2,1-3H3,(H3,14,16,19)
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
⚫
| legal_status =
⚫
| StdInChIKey = KEMXXQOFIRIICG-UHFFFAOYSA-N
⚫
| routes_of_administration = <!--Pharmacokinetic data-->
| CAS_number = 34866-47-2
| CAS_supplemental =
| bioavailability =
| ATC_prefix = R03
| protein_bound =
| ATC_suffix = CC10
| metabolism =
⚫
| ATC_supplemental =
| PubChem = 36976
⚫
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
⚫
| DrugBank =
| C=13 | H=21 | N=3 | O=3
| molecular_weight = 267.324 g/mol
| bioavailability =
| protein_bound =
⚫
| metabolism =
| elimination_half-life =
| elimination_half-life =
| excretion =
| excretion = <!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
⚫
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| CAS_number = 34866-47-2
⚫
| ATC_prefix = R03
⚫
| pregnancy_category=
| ATC_suffix = CC10
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
⚫
| ATC_supplemental =
⚫
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| ChEMBL_Ref = {{ebicite|changed|EBI}}
⚫
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| ChEMBL = 2110780
| legal_status =
| PubChem = 36976
⚫
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
⚫
| routes_of_administration =
| DrugBank =
⚫
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫
| ChemSpiderID = 33928
⚫
| UNII_Ref = {{fdacite|correct|FDA}}
⚫
| UNII = 0N12JR32MR

<!--Chemical data-->| C = 13
| H = 21
| N = 3
| O = 3
⚫
| smiles = O=C(Nc1cc(ccc1O)C(O)CNC(C)(C)C)N
⚫
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
⚫
| StdInChI = 1S/C13H21N3O3/c1-13(2,3)15-7-11(18)8-4-5-10(17)9(6-8)16-12(14)19/h4-6,11,15,17-18H,7H2,1-3H3,(H3,14,16,19)
⚫
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
⚫
| StdInChIKey = KEMXXQOFIRIICG-UHFFFAOYSA-N
}}
}}
'''Carbuterol''' ([[International Nonproprietary Name|INN]]; '''carbuterol hydrochloride''' [[United States Adopted Name|USAN]]) is a short-acting [[Beta2-adrenergic agonist|β<sub>2</sub> adrenoreceptor agonist]].<ref>{{cite journal | vauthors = Wardell JR, Colella DF, Shetzline A, Fowler PJ | title = Studies on carbuterol (SK & F 40383-A), a new selective bronchodilator agent | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 189 | issue = 1 | pages = 167–84 | date = April 1974 | pmid = 4823290 | url = http://jpet.aspetjournals.org/content/189/1/167.short }}</ref><ref>{{cite patent | inventor = Lunts LH, Collin DT | title = 1-phenyl-2-aminäthanol-Derivate und Verfahren zu ihrer Herstellung un ihre Verwendung | pubdate = 1970 | country = DE | number = 2032642 | assign1 = Allen & Hansburys Ltd }}</ref>
'''Carbuterol''' ([[International Nonproprietary Name|INN]]; [[United States Adopted Name|USAN]] '''carbuterol hydrochloride''') is a [[beta2-adrenergic receptor agonist|β<sub>2</sub>-agonist]].


==Synthesis==
[[File:Carbuterol.png|400px]]
[[File:Carbuterol synthesis.svg|thumb|center|700px|{{patent|DE|2032642}}]]

== References ==
{{Reflist}}


Lunts, L. H. C.; Collin, D. T.; German Patent, 1970, {{Cite patent|DE|2032642}}.
{{Adrenergic agonists}}
{{Adrenergic agonists}}
{{Asthma and copd rx}}
{{Asthma and copd rx}}


[[Category:Beta-adrenergic agonists]]
[[Category:Beta2-adrenergic agonists]]
[[Category:Phenethylamines]]
[[Category:Phenylethanolamines]]
[[Category:Ureas]]
[[Category:Ureas]]



{{respiratory-system-drug-stub}}
{{respiratory-system-drug-stub}}
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"