Fluorone: Difference between revisions

(12 intermediate revisions by 11 users not shown)

Line 1:

:''Not to be confused with [[fluorene]], [[fluorenone]], or [[fluorine]].''

{{Chembox

| verifiedrevid = ~~400094341~~

| verifiedrevid = 400095481

| ImageFile = Fluorone.png

| ImageAlt = Skeletal formula

| ImageSize = 200px

| ImageFile1 = Fluorone-3D-balls.png

⚫

| ~~IUPACName~~ = Xanthen-3-one

| ImageAlt1 = Ball-and-stick model

⚫

| PIN = 3''H''-Xanthen-3-one

| OtherNames = 3-Isoxanthone; 3-Oxo-3''H''-xanthene

| Section1 = {{Chembox Identifiers

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 9507995

| InChI = 1/C13H8O2/c14-11-6-5-10-7-9-3-1-2-4-12(9)15-13(10)8-11/h1-8H

Line 15:

Line 17:

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = FRIPRWYKBIOZJU-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 494-41-7

| UNII_Ref = {{fdacite|correct|FDA}}

⚫

| PubChem = 11333049

| UNII = 7X94VF2YWN

| SMILES = O=C/2/C=C\C1=C\c3c(O/C1=C\2)cccc3

⚫

| PubChem = 11333049

⚫

}}

| SMILES = O=C1C=CC2=Cc3ccccc3OC2=C1

⚫

| Section2 = {{Chembox Properties

⚫

}}

| C=13 | H=8 | O=2

⚫

|Section2={{Chembox Properties

| Appearance =

| ~~Density~~ =

| C=13 | H=8 | O=2

| ~~MeltingPt~~ =

| Appearance =

| ~~BoilingPt~~ =

| Density =

| ~~Solubility~~ = }}

| MeltingPt =

| BoilingPt =

⚫

| Section3 = {{Chembox Hazards

| ~~MainHazards~~ =

| Solubility =

}}

⚫

| FlashPt =

⚫

|Section3={{Chembox Hazards

| Autoignition = }}

| MainHazards =

⚫

| FlashPt =

| AutoignitionPt =

}}

'''Fluorone''' is a [[heterocycle|heterocyclic]] chemical compound. It forms the core structure for various chemicals, most notably fluorone [[dye]]s,<ref>{{cite journal | doi = 10.1021/jo00042a020 | ~~author~~ = Shi, Jianmin; Zhang, Xianping; Neckers, Douglas C | title = Xanthenes: fluorone derivatives | journal = [[Journal of Organic Chemistry]] | year = 1992 | volume = 57 | issue = 16 | pages = 4418–4421}}</ref> including [[erythrosine]]. It is an [[isomer]] of [[xanthone]], sometimes referred to as an isoxanthone.

'''Fluorone''' is a [[heterocycle|heterocyclic]] chemical compound. It forms the core structure for various chemicals, most notably fluorone [[dye]]s,<ref>{{cite journal | doi = 10.1021/jo00042a020 |author1=Shi, Jianmin |author2=Zhang, Xianping |author3=Neckers, Douglas C | title = Xanthenes: fluorone derivatives | journal = [[Journal of Organic Chemistry]] | year = 1992 | volume = 57 | issue = 16 | pages = 4418–4421}}</ref> including [[fluorescein]], [[erythrosine]] and [[rhodamine]]. It is an [[isomer]] of [[xanthone]], sometimes referred to as an isoxanthone.

[[File:Erythrosine.svg|thumb|left|Chemical structure of [[erythrosine]]]]{{clear-left}}

[[File:Erythrosine.svg|thumb|left|Chemical structure of [[erythrosine]]]]{{clear left}}

==~~References~~==

== See also ==

* [[Xanthene]]

== References ==

[[Category:Fluorones| ]]

Line 43:

Line 53:

[[fr:Fluorone]]

[[pt:Fluorona]]