Fluorone: Difference between revisions
Appearance
Content deleted Content added
Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:Wi |
Shinkolobwe (talk | contribs) →References: New section: == See also == |
||
(12 intermediate revisions by 11 users not shown) | |||
Line 1: | Line 1: | ||
{{distinguish|Fluorene|Fluorenone|Fluorine}} |
|||
:''Not to be confused with [[fluorene]], [[fluorenone]], or [[fluorine]].'' |
|||
{{Chembox |
{{Chembox |
||
| verifiedrevid = |
| verifiedrevid = 400095481 |
||
| ImageFile = Fluorone.png |
| ImageFile = Fluorone.png |
||
| ImageAlt = Skeletal formula |
|||
| ImageSize = 200px |
|||
| ImageFile1 = Fluorone-3D-balls.png |
|||
⚫ | |||
| ImageAlt1 = Ball-and-stick model |
|||
⚫ | |||
| OtherNames = 3-Isoxanthone; 3-Oxo-3''H''-xanthene |
| OtherNames = 3-Isoxanthone; 3-Oxo-3''H''-xanthene |
||
| |
|Section1={{Chembox Identifiers |
||
| |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 9507995 |
| ChemSpiderID = 9507995 |
||
| InChI = 1/C13H8O2/c14-11-6-5-10-7-9-3-1-2-4-12(9)15-13(10)8-11/h1-8H |
| InChI = 1/C13H8O2/c14-11-6-5-10-7-9-3-1-2-4-12(9)15-13(10)8-11/h1-8H |
||
Line 15: | Line 17: | ||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChIKey = FRIPRWYKBIOZJU-UHFFFAOYSA-N |
| StdInChIKey = FRIPRWYKBIOZJU-UHFFFAOYSA-N |
||
| CASNo_Ref = {{cascite|correct|??}} |
|||
| CASNo = 494-41-7 |
| CASNo = 494-41-7 |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
⚫ | |||
| UNII = 7X94VF2YWN |
|||
| SMILES = O=C/2/C=C\C1=C\c3c(O/C1=C\2)cccc3 |
|||
⚫ | |||
⚫ | |||
| SMILES = O=C1C=CC2=Cc3ccccc3OC2=C1 |
|||
⚫ | |||
⚫ | |||
| C=13 | H=8 | O=2 |
|||
⚫ | |||
| Appearance = |
|||
| |
| C=13 | H=8 | O=2 |
||
| |
| Appearance = |
||
| |
| Density = |
||
| |
| MeltingPt = |
||
| BoilingPt = |
|||
⚫ | |||
| |
| Solubility = |
||
}} |
|||
⚫ | |||
⚫ | |||
| Autoignition = }} |
|||
| MainHazards = |
|||
⚫ | |||
| AutoignitionPt = |
|||
}} |
|||
}} |
}} |
||
'''Fluorone''' is a [[heterocycle|heterocyclic]] chemical compound. It forms the core structure for various chemicals, most notably fluorone [[dye]]s,<ref>{{cite journal | doi = 10.1021/jo00042a020 | |
'''Fluorone''' is a [[heterocycle|heterocyclic]] chemical compound. It forms the core structure for various chemicals, most notably fluorone [[dye]]s,<ref>{{cite journal | doi = 10.1021/jo00042a020 |author1=Shi, Jianmin |author2=Zhang, Xianping |author3=Neckers, Douglas C | title = Xanthenes: fluorone derivatives | journal = [[Journal of Organic Chemistry]] | year = 1992 | volume = 57 | issue = 16 | pages = 4418–4421}}</ref> including [[fluorescein]], [[erythrosine]] and [[rhodamine]]. It is an [[isomer]] of [[xanthone]], sometimes referred to as an isoxanthone. |
||
[[File:Erythrosine.svg|thumb|left|Chemical structure of [[erythrosine]]]]{{clear |
[[File:Erythrosine.svg|thumb|left|Chemical structure of [[erythrosine]]]]{{clear left}} |
||
== |
== See also == |
||
* [[Xanthene]] |
|||
{{reflist}} |
|||
== References == |
|||
{{Reflist}} |
|||
[[Category:Fluorones| ]] |
[[Category:Fluorones| ]] |
||
Line 43: | Line 53: | ||
{{Heterocyclic-stub}} |
{{Heterocyclic-stub}} |
||
[[fr:Fluorone]] |
|||
[[pt:Fluorona]] |