Imuracetam: Difference between revisions

(15 intermediate revisions by 12 users not shown)

Line 1:

{{chembox

| Watchedfields = changed

⚫

| UNII_Ref = {{fdacite|correct|FDA}}

⚫

| verifiedrevid = 444589978

⚫

| UNII = 972FNV35ZM

⚫

| ImageFile = Imuracetam Structure.svg

⚫

| verifiedrevid = ~~437173420~~

⚫

| ImageFile = Imuracetam.~~png~~

| ImageSize = 140px

| ~~IUPACName~~ = ''N'',''N'''-~~''bis''~~[(2-oxopyrrolidin-1-yl)methyl]urea

| PIN = ''N'',''N''′-Bis[(2-oxopyrrolidin-1-yl)methyl]urea

| OtherNames =

| Section1 = {{Chembox Identifiers

|Section1={{Chembox Identifiers

⚫

| UNII_Ref = {{fdacite|correct|FDA}}

⚫

| UNII = 972FNV35ZM

| PubChem = 163319

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

Line 17:

Line 18:

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = WMKONRFEZGAHTE-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|correct|??}}

| CASNo =67542-41-0

| CASNo = 67542-41-0

| ATCCode_prefix =

| ChEMBL = 2106342

| ATCCode_suffix =

| SMILES = O=C(NCN1C(=O)CCC1)NCN2C(=O)CCC2

}}

| Section2 = {{Chembox Properties

|Section2={{Chembox Properties

~~| Formula =~~ | C=11 | H=18 | N=4 | O=3

| C=11 | H=18 | N=4 | O=3

| MolarMass = 254.286 g/mol

| Appearance =

| Density =

| ~~MeltingPt~~ =

| MeltingPtC = 184.5

| MeltingPt_ref= <ref name=Ganellin>{{cite book | title = Dictionary of Pharmacological Agents | volume = 3 | vauthors = Ganellin CR, Triggle DJ | publisher = CRC Press | date = 1996}}</ref>

| BoilingPt =

| Solubility = }}

| Section5 = {{Chembox Pharmacology

|Section5={{Chembox Pharmacology

| AdminRoutes =

| Bioavail =

Line 42:

Line 43:

| Legal_AU =

| Legal_CA =

| ~~PregCat~~ =

| Pregnancy_category =

| ~~PregCat_AU~~ =

| Pregnancy_AU =

| ~~PregCat_US~~ = }}

| Pregnancy_US = }}

}}

'''Imuracetam''' is a ~~[[nootropic]]~~ drug of the [[racetam]] family.<ref>Avetisyan SA, Kocharov SL, Azaryan LV, Dzhagatspanyan IA, Melikyan GG. Synthesis and psychotropic activity of new 2-pyrrolidone derivatives. ''Pharmaceutical Chemistry Journal~~''.~~ 1998; 32(2~~):55-58~~.</ref>

'''Imuracetam''' is a drug of the [[racetam]] family.<ref>{{cite journal | vauthors = Avetisyan SA, Kocharov SL, Azaryan LV, Dzhagatspanyan IA, Melikyan GG | title = Synthesis and psychotropic activity of new 2-pyrrolidone derivatives. | journal = Pharmaceutical Chemistry Journal | date = February 1998 | volume = 32 | issue = 2 | pages = 55–8 | doi = 10.1007/BF02464161 | s2cid = 29810469 }}</ref> It was under development in the 1970s, but was never marketed.<ref name=Ganellin/>

==References==

Line 56:

Line 57:

[[Category:Racetams]]

[[Category:Pyrrolidones]]

⚫

[[Category:~~Nootropics~~]]

[[Category:Ureas]]

⚫

[[Category:Abandoned drugs]]