Jump to content

Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Minodronic acid: Difference between pages

(Difference between pages)
Page 1
Page 2
Content deleted Content added
VisualWikitext
Saving copy of the {{chembox}} taken from revid 456573206 of page Minodronic_acid for the Chem/Drugbox validation project (updated: 'ChEMBL', 'UNII', 'CASNo').
 
Citation bot (talk | contribs)
Bots
5,141,383 edits
Alter: title. | Use this bot. Report bugs. | Suggested by Abductive | Category:Multiple chemicals in an infobox that need indexing | #UCB_Category 453/1863
 
Line 1: Line 1:
{{distinguish|mildronate|medronate}}
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:Minodronic_acid|oldid=456573206}} 456573206] of page [[Minodronic_acid]] with values updated to verified values.}}
{{chembox
{{chembox
| Verifiedfields = changed
| Verifiedfields = changed
| UNII_Ref = {{fdacite|changed|FDA}}
| Watchedfields = changed
⚫
| verifiedrevid = 462252636
| UNII = <!-- blanked - oldvalue: 40SGR63TGL -->
⚫
| verifiedrevid = 403957731
| ImageFile = Minodronic acid.svg
| ImageFile = Minodronic acid.svg
| ImageSize = 150px
| ImageSize = 150px
| ImageAlt =
| ImageAlt =
| IUPACName = (1-Hydroxy-2-imidazo[1,2-a]pyridin-3-yl-1-phosphonoethyl)phosphonic acid
| PIN = [1-Hydroxy-2-(imidazo[1,2-''a'']pyridin-3-yl)ethane-1,1-diyl]bis(phosphonic acid)
| OtherNames = Minodronate; YM 529
| OtherNames = Minodronate; YM 529
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
⚫
| UNII_Ref = {{fdacite|correct|FDA}}
⚫
| CASNo = <!-- blanked - oldvalue: 180064-38-4 -->
| UNII = 40SGR63TGL
⚫
| CASNo_Ref = {{cascite|correct|??}}
⚫
| UNII1_Ref = {{fdacite|correct|FDA}}
⚫
| CASNo1 = 155648-60-5
| UNII1 = 457X74V7ND
⚫
| CASNo1_Comment = (hydrate)
| UNII1_Comment = (monohydrate)
⚫
| CASNo1_Ref = {{cascite|correct}}
| ChEMBL = 319144
| IUPHAR_ligand = 3164
⚫
| CASNo = 180064-38-4
| CASNo_Ref = {{cascite|correct|CAS}}
⚫
| CASNo1 = 155648-60-5
⚫
| CASNo1_Comment = (monohydrate)
| CASNo1_Ref = {{cascite|correct|CAS}}
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 319144
| PubChem = 130956
| PubChem = 130956
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 115805
| ChemSpiderID = 115805
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = VMMKGHQPQIEGSQ-UHFFFAOYSA-N
| StdInChIKey = VMMKGHQPQIEGSQ-UHFFFAOYSA-N
| SMILES = O=P(O)(O)C(O)(P(=O)(O)O)Cc1cnc2ccccn12
| SMILES = O=P(O)(O)C(O)(P(=O)(O)O)Cc1cnc2ccccn12
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C9H12N2O7P2/c12-9(19(13,14)15,20(16,17)18)5-7-6-10-8-3-1-2-4-11(7)8/h1-4,6,12H,5H2,(H2,13,14,15)(H2,16,17,18)}}
| StdInChI = 1S/C9H12N2O7P2/c12-9(19(13,14)15,20(16,17)18)5-7-6-10-8-3-1-2-4-11(7)8/h1-4,6,12H,5H2,(H2,13,14,15)(H2,16,17,18)}}
| Section2 = {{Chembox Properties
|Section2={{Chembox Properties
| C=9|H=12|N=2|O=7|P=2
| C=9 | H=12 | N=2 | O=7 | P=2
| Appearance =
| Appearance =
| Density =
| Density =
| MeltingPt =
| MeltingPt =
| BoilingPt =
| BoilingPt =
| Solubility = }}
| Solubility = }}
| Section3 = {{Chembox Hazards
|Section3={{Chembox Hazards
| MainHazards =
| MainHazards =
| FlashPt =
| FlashPt =
| Autoignition = }}
| AutoignitionPt = }}
| Section5 = {{Chembox Pharmacology
|Section5={{Chembox Pharmacology
| AdminRoutes =
| AdminRoutes =
| Bioavail =
| Bioavail =
| Metabolism =
| Metabolism =
| HalfLife =
| HalfLife =
| ProteinBound =
| ProteinBound =
| Excretion =
| Excretion =
| Legal_status =
| Legal_status =
| Legal_US =
| Legal_US =
| Legal_UK =
| Legal_UK =
| Legal_AU =
| Legal_AU =
| Legal_CA =
| Legal_CA =
| PregCat =
| PregCat =
| PregCat_AU =
| PregCat_AU =
| PregCat_US = }}
| PregCat_US = }}
}}
}}

'''Minodronic acid''' is a third-generation [[bisphosphonate]] drug. It is approved for use in Japan for the treatment of [[osteoporosis]].<ref>{{cite journal | journal = Annual Reports in Medicinal Chemistry | volume = 45 | title = To Market, To Market - 2009. 16. Minodronic acid | pages = 509–510 | author = Shridhar Hegde and Michelle Schmidt | year = 2009 | doi=10.1016/s0065-7743(10)45028-9}}</ref> Its [[mechanism of action]] involves [[enzyme inhibitor|inhibition]] of [[farnesyl pyrophosphate synthase]] activity.<ref>{{cite journal | doi = 10.1358/dof.2002.027.10.701186 | last1 = Sorbera | first1 = L.A. | last2 = Castañer | first2 = J. | last3 = Leeson | first3 = P.A. | title = Minodronic Acid | journal = Drugs of the Future | year = 2002 | volume = 27 | issue = 10 | pages = 935–941}}</ref>

==References==
{{reflist}}

{{Drugs for treatment of bone diseases}}

[[Category:Bisphosphonates]]
[[Category:Imidazopyridines]]

{{musculoskeletal-drug-stub}}
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"