Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Minodronic acid: Difference between pages
Appearance
(Difference between pages)
Content deleted Content added
Saving copy of the {{chembox}} taken from revid 456573206 of page Minodronic_acid for the Chem/Drugbox validation project (updated: 'ChEMBL', 'UNII', 'CASNo'). |
Citation bot (talk | contribs) Alter: title. | Use this bot. Report bugs. | Suggested by Abductive | Category:Multiple chemicals in an infobox that need indexing | #UCB_Category 453/1863 |
||
Line 1: | Line 1: | ||
{{distinguish|mildronate|medronate}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:Minodronic_acid|oldid=456573206}} 456573206] of page [[Minodronic_acid]] with values updated to verified values.}} |
|||
{{chembox |
{{chembox |
||
| Verifiedfields = changed |
| Verifiedfields = changed |
||
| |
| Watchedfields = changed |
||
⚫ | |||
| UNII = <!-- blanked - oldvalue: 40SGR63TGL --> |
|||
⚫ | |||
| ImageFile = Minodronic acid.svg |
| ImageFile = Minodronic acid.svg |
||
| |
| ImageSize = 150px |
||
| |
| ImageAlt = |
||
| |
| PIN = [1-Hydroxy-2-(imidazo[1,2-''a'']pyridin-3-yl)ethane-1,1-diyl]bis(phosphonic acid) |
||
| OtherNames = Minodronate; YM 529 |
| OtherNames = Minodronate; YM 529 |
||
| |
|Section1={{Chembox Identifiers |
||
⚫ | |||
⚫ | |||
| UNII = 40SGR63TGL |
|||
⚫ | |||
⚫ | |||
⚫ | |||
| UNII1 = 457X74V7ND |
|||
⚫ | |||
| UNII1_Comment = (monohydrate) |
|||
⚫ | |||
| |
| IUPHAR_ligand = 3164 |
||
⚫ | |||
| CASNo_Ref = {{cascite|correct|CAS}} |
|||
⚫ | |||
⚫ | |||
| CASNo1_Ref = {{cascite|correct|CAS}} |
|||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|||
| ChEMBL = 319144 |
|||
| PubChem = 130956 |
| PubChem = 130956 |
||
| |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 115805 |
| ChemSpiderID = 115805 |
||
| |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChIKey = VMMKGHQPQIEGSQ-UHFFFAOYSA-N |
| StdInChIKey = VMMKGHQPQIEGSQ-UHFFFAOYSA-N |
||
| SMILES = O=P(O)(O)C(O)(P(=O)(O)O)Cc1cnc2ccccn12 |
| SMILES = O=P(O)(O)C(O)(P(=O)(O)O)Cc1cnc2ccccn12 |
||
| |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C9H12N2O7P2/c12-9(19(13,14)15,20(16,17)18)5-7-6-10-8-3-1-2-4-11(7)8/h1-4,6,12H,5H2,(H2,13,14,15)(H2,16,17,18)}} |
| StdInChI = 1S/C9H12N2O7P2/c12-9(19(13,14)15,20(16,17)18)5-7-6-10-8-3-1-2-4-11(7)8/h1-4,6,12H,5H2,(H2,13,14,15)(H2,16,17,18)}} |
||
| |
|Section2={{Chembox Properties |
||
| |
| C=9 | H=12 | N=2 | O=7 | P=2 |
||
| |
| Appearance = |
||
| |
| Density = |
||
| |
| MeltingPt = |
||
| |
| BoilingPt = |
||
| |
| Solubility = }} |
||
| |
|Section3={{Chembox Hazards |
||
| |
| MainHazards = |
||
| |
| FlashPt = |
||
| |
| AutoignitionPt = }} |
||
| |
|Section5={{Chembox Pharmacology |
||
| |
| AdminRoutes = |
||
| |
| Bioavail = |
||
| |
| Metabolism = |
||
| |
| HalfLife = |
||
| |
| ProteinBound = |
||
| |
| Excretion = |
||
| |
| Legal_status = |
||
| |
| Legal_US = |
||
| |
| Legal_UK = |
||
| |
| Legal_AU = |
||
| |
| Legal_CA = |
||
| |
| PregCat = |
||
| |
| PregCat_AU = |
||
| |
| PregCat_US = }} |
||
}} |
}} |
||
'''Minodronic acid''' is a third-generation [[bisphosphonate]] drug. It is approved for use in Japan for the treatment of [[osteoporosis]].<ref>{{cite journal | journal = Annual Reports in Medicinal Chemistry | volume = 45 | title = To Market, To Market - 2009. 16. Minodronic acid | pages = 509–510 | author = Shridhar Hegde and Michelle Schmidt | year = 2009 | doi=10.1016/s0065-7743(10)45028-9}}</ref> Its [[mechanism of action]] involves [[enzyme inhibitor|inhibition]] of [[farnesyl pyrophosphate synthase]] activity.<ref>{{cite journal | doi = 10.1358/dof.2002.027.10.701186 | last1 = Sorbera | first1 = L.A. | last2 = Castañer | first2 = J. | last3 = Leeson | first3 = P.A. | title = Minodronic Acid | journal = Drugs of the Future | year = 2002 | volume = 27 | issue = 10 | pages = 935–941}}</ref> |
|||
==References== |
|||
{{reflist}} |
|||
{{Drugs for treatment of bone diseases}} |
|||
[[Category:Bisphosphonates]] |
|||
[[Category:Imidazopyridines]] |
|||
{{musculoskeletal-drug-stub}} |