Jump to content

Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Pulegone: Difference between pages

(Difference between pages)
Page 1
Page 2
Content deleted Content added
Saving copy of the {{chembox}} taken from revid 444074446 of page Pulegone for the Chem/Drugbox validation project (updated: '').
 
m →‎top: Chembox: fix unknown parameters, replaced: | RPhrases = | → | HPhrases = |, | SPhrases = | → | PPhrases = | GHS_ref = |, | EUClass = | → | (2)
 
Line 1: Line 1:
{{Use dmy dates|date=September 2021}}
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:Pulegone|oldid=444074446}} 444074446] of page [[Pulegone]] with values updated to verified values.}}
{{chembox
{{Chembox
| Watchedfields = changed
| verifiedrevid = 444072653
| verifiedrevid = 464376356
| Reference = <ref>''Merck Index'', 11th Edition, '''7955'''.</ref>
| Reference = <ref>''Merck Index'', 11th Edition, '''7955'''.</ref>
| ImageFile = Pulegone Structural Formulae.png
| ImageFile = Pulegone Structural Formulae.png
| ImageSize = 220px
| ImageSize = 220px
| IUPACName = (''R'')-5-Methyl-2-(1-methylethylidine)cyclohexanone
| PIN = (5''R'')-5-Methyl-2-(propan-2-ylidene)cyclohexan-1-one
| OtherNames = ''p''-Menth-4(8)-en-3-one; <br>δ-4(8)-p-menthen-3-one; <br>(''R'')-2-Isopropylidene-5-methylcyclohexanone; <br>(''R'')-''p''-Menth-4(8)-en-3-one; <br>(''R'')-(+)-Pulegone
| OtherNames = ''p''-Menth-4(8)-en-3-one; <br>δ-4(8)-''p''-Menthen-3-one; <br>(''R'')-2-Isopropylidene-5-methylcyclohexanone; <br>(''R'')-''p''-Menth-4(8)-en-3-one; <br>(''R'')-(+)-Pulegone
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
| Abbreviations =
| Abbreviations =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
Line 24: Line 25:
| UNII = 4LF2673R3G
| UNII = 4LF2673R3G
| SMILES = O=C1/C(=C(/C)C)CC[C@@H](C)C1
| SMILES = O=C1/C(=C(/C)C)CC[C@@H](C)C1
| InChI =
| RTECS =
| RTECS =
| MeSHName =
| MeSHName =
Line 31: Line 31:
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG =
| KEGG =
}}
| ATCCode_prefix =
|Section2={{Chembox Properties
| ATCCode_suffix =
| C=10 | H=16 | O=1
| ATC_Supplemental =}}
| Section2 = {{Chembox Properties
| Formula = C<sub>10</sub>H<sub>16</sub>O
| MolarMass = 152.23 g/mol
| Appearance = Colorless oil
| Appearance = Colorless oil
| Density = 0.9346 g/cm<sup>3</sup>
| Density = 0.9346 g/cm<sup>3</sup>
| MeltingPt =
| MeltingPt =
| Melting_notes =
| MeltingPt_notes =
| BoilingPtC = 224
| BoilingPtC = 224
| Boiling_notes =
| BoilingPt_notes =
| Solubility = Insoluble
| Solubility = Insoluble
| SolubleOther = Miscible
| SolubleOther = Miscible
| Solvent = [[Ethanol]]<br>[[diethyl ether|Ether]]<br>[[Chloroform]]
| Solvent = [[Ethanol]]<br>[[diethyl ether|Ether]]<br>[[Chloroform]]
| pKa =
| pKa =
| pKb = }}
| pKb =
}}
| Section7 = {{Chembox Hazards
|Section7={{Chembox Hazards
| ExternalMSDS = [http://notes.ump.edu.my/fkksa/FKKSA/Archive/Technical%20Unit/Warehouse%20Unit/Chemical/MSDS/MERCK_EN/8186/818665.pdf MSDS]<ref name=sds>{{cite web
| ExternalSDS = [http://notes.ump.edu.my/fkksa/FKKSA/Archive/Technical%20Unit/Warehouse%20Unit/Chemical/MSDS/MERCK_EN/8186/818665.pdf MSDS]<ref name=sds>{{cite web| last =[[Universiti Malaysia Pahang]]| title =Safety data sheet| url =http://notes.ump.edu.my/fkksa/FKKSA/Archive/Technical%20Unit/Warehouse%20Unit/Chemical/MSDS/MERCK_EN/8186/818665.pdf| access-date =8 June 2009}}{{dead link|date=April 2018 |bot=InternetArchiveBot |fix-attempted=yes }}</ref>
| last = [[Universiti Malaysia Pahang]]
| first =
| authorlink =
| coauthors =
| title = Safety data sheet
| work =
| publisher =
| date =
| url = http://notes.ump.edu.my/fkksa/FKKSA/Archive/Technical%20Unit/Warehouse%20Unit/Chemical/MSDS/MERCK_EN/8186/818665.pdf
| format =
| doi =
| accessdate = 8 June 2009 }}</ref>
| EUClass =
| EUIndex =
| MainHazards =
| MainHazards =
| NFPA-H =
| NFPA-H =
| NFPA-F =
| NFPA-F =
| NFPA-R =
| NFPA-R =
| NFPA-O =
| NFPA-S =
| RPhrases =
| HPhrases =
| SPhrases =
| PPhrases =
| RSPhrases =
| GHS_ref =
| FlashPt =
| FlashPt =
| Autoignition =
| AutoignitionPt =
| ExploLimits =
| ExploLimits =
| PEL = }}
| PEL =
}}
}}
}}

'''Pulegone''' is a naturally occurring [[organic compound]] obtained from the [[essential oil]]s of a variety of plants such as ''[[Nepeta cataria]]'' ([[catnip]]), ''[[Mentha piperita]]'', and [[Mentha pulegium|pennyroyal]].<ref>{{cite journal | author = Grundschober, F. | year = 1979 | title = Literature review of pulegone | journal = Perfum. Flavorist | volume = 4 | pages = 15–17}}</ref><ref>{{cite journal | author = Sullivan, J.B., Rumack, B.H., Thomas, H., Peterson, R.G. & Brysch, P. | year = 1979 | title = Pennyroyal oil poisoning and hepatotoxicity | journal = J. Am. Med. Assoc. | volume = 242 | pages = 2873–2874 | doi = 10.1001/jama.1979.03300260043027 | issue = 26| pmid = 513258 }}</ref> It is classified as a [[monoterpene]].

Pulegone is a clear colorless oily liquid and has a pleasant odor similar to pennyroyal, [[peppermint]] and [[camphor]]. It is used in flavoring agents, in [[perfumery]], and in [[aromatherapy]].

==Toxicology==
It was reported that the chemical is toxic to rats if a large quantity is consumed.<ref name=stts>{{cite journal
| last1 = Thorup
| first1 = I.
| title = Short term toxicity study in rats dosed with pulegone and menthol
| journal = [[Toxicology Letters]]
| volume = 19
| issue = 3
| pages = 207–210
| year = 1983
| doi = 10.1016/0378-4274(83)90120-0
| pmid = 6658833
| last2 = Würtzen
| first2 = G
| last3 = Carstensen
| first3 = J
| last4 = Olsen
| first4 = P|display-authors=etal}}</ref><ref name=edmq>{{cite journal
| last1 = Asekun
| first1 = O.T.
| title = Effects of drying methods on the quality and quantity of the essential oil of ''Mentha longifolia'' L. subsp. ''Capensis''
| journal = Food Chemistry
| volume = 101
| issue = 3
| pages = 995–998
| year = 2006
| doi = 10.1016/j.foodchem.2006.02.052
| last2 = Grierson
| first2 = D
| last3 = Afolayan
| first3 = A|display-authors=etal}}</ref>

Pulegone is also an insecticide − the most powerful of three insecticides naturally occurring in many mint species.<ref>{{cite journal|last=Franzios|first=G|author2=Mirotsou M|author3=Hatziapostolou E|author4=Kral J|author5=Scouras ZG|author6=Mavragani-Tsipidou P|title=Insecticidal and genotoxic activities of mint essential oils|journal=Journal of Agricultural and Food Chemistry|date=16 July 1997|pages=2690–2694|doi=10.1021/jf960685f|url=http://ukpmc.ac.uk/abstract/AGR/IND21242689/reload=0;jsessionid=IzuDur4k1KjWolRsRlm2.0|archive-url=https://archive.today/20121223054744/http://ukpmc.ac.uk/abstract/AGR/IND21242689/reload=0;jsessionid=IzuDur4k1KjWolRsRlm2.0|url-status=dead|archive-date=23 December 2012|access-date=19 October 2012|volume=45|issue=7}}</ref>

As of October 2018, the [[Food and Drug Administration|FDA]] withdrew authorization for the use of pulegone as a synthetic flavoring substance for use in food, but that naturally-occurring pulegone can continue to be used.<ref>{{Federal Register|83|50490}}</ref>

==Sources==
* [[Glechoma hederacea|Creeping charlie]]
* ''[[Mentha longifolia]]''<ref name=edmq />
* ''[[Mentha suaveolens]]''<ref name="pmid25985361">{{cite journal |vauthors=Božović M, Pirolli A, Ragno R |title=Mentha suaveolens Ehrh. (Lamiaceae) Essential Oil and Its Main Constituent Piperitenone Oxide: Biological Activities and Chemistry |journal=[[Molecules (Basel, Switzerland)]] |volume=20 |issue=5 |pages=8605–33 |date=May 2015 |pmid=25985361 |pmc=6272761 |doi=10.3390/molecules20058605 |doi-access=free }}</ref>
* [[Mentha pulegium|Pennyroyal]]<ref name=hptp>{{cite journal
| last = Gordon
| first = W. Perry
| author2=Valerie Howland
| title = Hepatotoxicity and pulmonary toxicity of pennyroyal oil and its constituent terpenes in the mouse
| journal = [[Toxicology and Applied Pharmacology]]
| volume = 65
| issue = 3
| pages = 413–424
| year = 1982
| doi = 10.1016/0041-008X(82)90387-8
| pmid = 7157374|display-authors=etal
}}</ref>
* [[Peppermint]]<ref name=nvpc>{{cite journal
| last = Farley
| first = Derek R.
| author2=Valerie Howland
| title = The natural variation of the pulegone content in various oils of peppermint
| journal = Journal of the Science of Food and Agriculture
| volume = 31
| issue = 11
| pages = 1143–1151
| year = 2006
| doi = 10.1002/jsfa.2740311104
}}</ref>
*''[[Schizonepeta| Schizonepeta tenuifolia]]''
*''[[Bursera graveolens]]''

== See also ==
* [[Menthofuran]]
* [[Menthol]]

== References ==
{{reflist}}

{{Terpenoids}}

[[Category:Ketones]]
[[Category:Flavors]]
[[Category:Cooling flavors]]
[[Category:Perfume ingredients]]
[[Category:Monoterpenes]]
[[Category:IARC Group 2B carcinogens]]