Retusin (flavonol): Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
 {{distinguish|retusin (isoflavone)}}
 {{chembox
+| Verifiedfields = changed
-| verifiedrevid = 407331260
+| Watchedfields = changed
+| verifiedrevid = 449638802
 | Name = Retusin
 | ImageFile = Retusin.svg
 | ImageSize = 250px
 | ImageName = Chemical structure of
-| IUPACName = 2-(3,4-dimethoxyphenyl)-5-hydroxy-3,7-dimethoxychromen-4-one
+| IUPACName = 5-Hydroxy-3,3′,4′,7-tetramethoxyflavone
+| SystematicName = 2-(3,4-Dimethoxyphenyl)-5-hydroxy-3,7-dimethoxy-4''H''-1-benzopyran-4-one
 | OtherNames = Quercetin tetramethylether<br>Quercetin-3,7,3',4'-tetramethyl ether<br>Tetramethylquercetin<br>Retusine
-|Section1= {{Chembox Identifiers
+|Section1={{Chembox Identifiers
+| CASNo_Ref = {{cascite|correct|??}}
 | CASNo = 1245-15-4
-| CASNo_Ref =
+| CASNoOther =
+| UNII_Ref = {{fdacite|correct|FDA}}
-| CASOther =
+| UNII = M8591903SD
 | PubChem = 5352005
 | SMILES = COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)OC)O)OC)OC
-| InChI =
+| EINECS = 214-991-4
+| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
-| MeSHName =
+| ChemSpiderID = 4508983
+| InChI = 1/C19H18O7/c1-22-11-8-12(20)16-15(9-11)26-18(19(25-4)17(16)21)10-5-6-13(23-2)14(7-10)24-3/h5-9,20H,1-4H3
+| InChIKey = HHGPYJLEJGNWJA-UHFFFAOYAJ
+| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
+| StdInChI = 1S/C19H18O7/c1-22-11-8-12(20)16-15(9-11)26-18(19(25-4)17(16)21)10-5-6-13(23-2)14(7-10)24-3/h5-9,20H,1-4H3
+| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
+| StdInChIKey = HHGPYJLEJGNWJA-UHFFFAOYSA-N
+| ChEBI = 144861
+| ChEMBL_Ref = {{ebicite|changed|EBI}}
+| ChEMBL = 77966
 }}
-|Section2= {{Chembox Properties
+|Section2={{Chembox Properties
 | Formula = C<sub>19</sub>H<sub>18</sub>O<sub>7</sub>
 | MolarMass = 358.34 g/mol
-| ExactMass = 358.105253 u
 | Appearance =
 | Density =
-| MeltingPt = <!-- °C -->
+| MeltingPt =
-| BoilingPt = <!-- °C -->
+| BoilingPt =
 | Solubility =
 }}
 }}
-'''Retusin''' is a [[O-methylated flavonol]], a type of flavonoid. It can be found in ''[[Origanum vulgare]]''<ref>[http://www.sciencedirect.com/science?_ob=ArticleURL&_udi=B6T4R-4SSGCR8-1&_user=4296857&_coverDate=08%2F31%2F2008&_rdoc=1&_fmt=high&_orig=search&_sort=d&_docanchor=&view=c&_acct=C000012518&_version=1&_urlVersion=0&_userid=4296857&md5=c679acfd8878a2004c6d481e7b989eab Exudate flavones and flavanones in Origanum species and their interspecific variation. Melpomene Skoula, Renée J. Grayer, Geoffrey C. Kite and Nigel C. Veitch, Biochemical Systematics and Ecology, Volume 36, Issue 8, August 2008, Pages 646-654]</ref> and in ''[[Ariocarpus retusus]]''.<ref>[http://kanaya.naist.jp/knapsack_jsp/information.jsp?word=C00004653 Retusin (Ariocarpus) on kanaya.naist.jp]</ref>
+'''Retusin''' is an [[O-methylated flavonol]], a type of flavonoid. It can be found in ''[[Origanum vulgare]]''<ref>[https://archive.today/20120908230042/http://www.sciencedirect.com/science?_ob=ArticleURL&_udi=B6T4R-4SSGCR8-1&_user=4296857&_coverDate=08/31/2008&_rdoc=1&_fmt=high&_orig=search&_sort=d&_docanchor=&view=c&_acct=C000012518&_version=1&_urlVersion=0&_userid=4296857&md5=c679acfd8878a2004c6d481e7b989eab Exudate flavones and flavanones in Origanum species and their interspecific variation. Melpomene Skoula, Renée J. Grayer, Geoffrey C. Kite and Nigel C. Veitch, Biochemical Systematics and Ecology, Volume 36, Issue 8, August 2008, Pages 646-654]</ref> and in ''[[Ariocarpus retusus]]''.<ref>[http://kanaya.naist.jp/knapsack_jsp/information.jsp?word=C00004653 Retusin (Ariocarpus) on kanaya.naist.jp]</ref>
-==References==
+== References ==
 {{reflist}}
@@ Line 38: / Line 52: @@
 {{flavonol}}
-[[Category:Flavonols]]
+[[Category:O-methylated flavonols]]
-[[Category:Phenol ethers]]
+{{aromatic-stub}}
-{{Natural-phenol-stub}}