Retusin (flavonol): Difference between revisions
Appearance
Content deleted Content added
m WP:CHECKWIKI error 18 fixes + general fixes (BRFA 15) using AWB (7832) |
move systematic name |
||
(16 intermediate revisions by 14 users not shown) | |||
Line 1: | Line 1: | ||
{{distinguish|retusin (isoflavone)}} |
{{distinguish|retusin (isoflavone)}} |
||
{{chembox |
{{chembox |
||
| Verifiedfields = changed |
|||
⚫ | |||
| Watchedfields = changed |
|||
⚫ | |||
| Name = Retusin |
| Name = Retusin |
||
| ImageFile = Retusin.svg |
| ImageFile = Retusin.svg |
||
| ImageSize = 250px |
| ImageSize = 250px |
||
| ImageName = Chemical structure of |
| ImageName = Chemical structure of |
||
| IUPACName = |
| IUPACName = 5-Hydroxy-3,3′,4′,7-tetramethoxyflavone |
||
| SystematicName = 2-(3,4-Dimethoxyphenyl)-5-hydroxy-3,7-dimethoxy-4''H''-1-benzopyran-4-one |
|||
| OtherNames = Quercetin tetramethylether<br>Quercetin-3,7,3',4'-tetramethyl ether<br>Tetramethylquercetin<br>Retusine |
| OtherNames = Quercetin tetramethylether<br>Quercetin-3,7,3',4'-tetramethyl ether<br>Tetramethylquercetin<br>Retusine |
||
|Section1= |
|Section1={{Chembox Identifiers |
||
| CASNo_Ref = {{cascite|correct|??}} |
|||
| CASNo = 1245-15-4 |
| CASNo = 1245-15-4 |
||
| |
| CASNoOther = |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| CASOther = |
|||
| UNII = M8591903SD |
|||
| PubChem = 5352005 |
| PubChem = 5352005 |
||
| SMILES = COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)OC)O)OC)OC |
| SMILES = COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)OC)O)OC)OC |
||
| |
| EINECS = 214-991-4 |
||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|||
| MeSHName = |
|||
| ChemSpiderID = 4508983 |
|||
| InChI = 1/C19H18O7/c1-22-11-8-12(20)16-15(9-11)26-18(19(25-4)17(16)21)10-5-6-13(23-2)14(7-10)24-3/h5-9,20H,1-4H3 |
|||
| InChIKey = HHGPYJLEJGNWJA-UHFFFAOYAJ |
|||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChI = 1S/C19H18O7/c1-22-11-8-12(20)16-15(9-11)26-18(19(25-4)17(16)21)10-5-6-13(23-2)14(7-10)24-3/h5-9,20H,1-4H3 |
|||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChIKey = HHGPYJLEJGNWJA-UHFFFAOYSA-N |
|||
| ChEBI = 144861 |
|||
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|||
| ChEMBL = 77966 |
|||
}} |
}} |
||
|Section2= |
|Section2={{Chembox Properties |
||
| Formula = C<sub>19</sub>H<sub>18</sub>O<sub>7</sub> |
| Formula = C<sub>19</sub>H<sub>18</sub>O<sub>7</sub> |
||
| MolarMass = 358.34 g/mol |
| MolarMass = 358.34 g/mol |
||
| ExactMass = 358.105253 u |
|||
| Appearance = |
| Appearance = |
||
| Density = |
| Density = |
||
| MeltingPt = |
| MeltingPt = |
||
| BoilingPt = |
| BoilingPt = |
||
| Solubility = |
| Solubility = |
||
}} |
}} |
||
}} |
}} |
||
'''Retusin''' is |
'''Retusin''' is an [[O-methylated flavonol]], a type of flavonoid. It can be found in ''[[Origanum vulgare]]''<ref>[https://archive.today/20120908230042/http://www.sciencedirect.com/science?_ob=ArticleURL&_udi=B6T4R-4SSGCR8-1&_user=4296857&_coverDate=08/31/2008&_rdoc=1&_fmt=high&_orig=search&_sort=d&_docanchor=&view=c&_acct=C000012518&_version=1&_urlVersion=0&_userid=4296857&md5=c679acfd8878a2004c6d481e7b989eab Exudate flavones and flavanones in Origanum species and their interspecific variation. Melpomene Skoula, Renée J. Grayer, Geoffrey C. Kite and Nigel C. Veitch, Biochemical Systematics and Ecology, Volume 36, Issue 8, August 2008, Pages 646-654]</ref> and in ''[[Ariocarpus retusus]]''.<ref>[http://kanaya.naist.jp/knapsack_jsp/information.jsp?word=C00004653 Retusin (Ariocarpus) on kanaya.naist.jp]</ref> |
||
==References== |
== References == |
||
{{reflist}} |
{{reflist}} |
||
Line 38: | Line 52: | ||
{{flavonol}} |
{{flavonol}} |
||
[[Category: |
[[Category:O-methylated flavonols]] |
||
[[Category:Phenol ethers]] |
|||
{{aromatic-stub}} |
|||
{{Natural-phenol-stub}} |